3,3',5,5'-Tetra-tert-butyl-2,2'-biphenyldiol structure
|
Common Name | 3,3',5,5'-Tetra-tert-butyl-2,2'-biphenyldiol | ||
|---|---|---|---|---|
| CAS Number | 6390-69-8 | Molecular Weight | 410.63200 | |
| Density | 1.12g/cm3 | Boiling Point | 469.3ºC at 760 mmHg | |
| Molecular Formula | C28H42O2 | Melting Point | 194-195ºC | |
| MSDS | N/A | Flash Point | 186.8ºC | |
| Name | 2,4-ditert-butyl-6-(3,5-ditert-butyl-2-hydroxyphenyl)phenol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.12g/cm3 |
|---|---|
| Boiling Point | 469.3ºC at 760 mmHg |
| Melting Point | 194-195ºC |
| Molecular Formula | C28H42O2 |
| Molecular Weight | 410.63200 |
| Flash Point | 186.8ºC |
| Exact Mass | 410.31800 |
| PSA | 40.46000 |
| LogP | 7.95480 |
| Index of Refraction | 1.6 |
| InChIKey | GDGDLBOVIAWEAD-UHFFFAOYSA-N |
| SMILES | CC(C)(C)c1cc(-c2cc(C(C)(C)C)cc(C(C)(C)C)c2O)c(O)c(C(C)(C)C)c1 |
| Precursor 8 | |
|---|---|
| DownStream 6 | |
| HS Code | 2907299090 |
|---|---|
| Summary | 2907299090 polyphenols; phenol-alcohols。supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward)。VAT:17.0%。tax rebate rate:9.0%。MFN tariff:5.5%。general tariff:30.0% |
| 3,3',5,5'-tetra-tert-butylbiphenyl-2,2'-diol |
| 2,2'-Dihydroxy-3,3',5,5'-tetra-tert-butylbiphenyl |
| 3,3',5,5'-Tetra-tert-butyl-2,2'-biphenyldiol |