diiodotriphenylphosphorane structure
|
Common Name | diiodotriphenylphosphorane | ||
|---|---|---|---|---|
| CAS Number | 6396-07-2 | Molecular Weight | 516.09400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H15I2P | Melting Point | 210-220ºC(lit.) | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Symbol |
GHS05, GHS08 |
Signal Word | Danger | |
| Name | diiodo(triphenyl)-λ5-phosphane |
|---|---|
| Synonym | More Synonyms |
| Melting Point | 210-220ºC(lit.) |
|---|---|
| Molecular Formula | C18H15I2P |
| Molecular Weight | 516.09400 |
| Exact Mass | 515.90000 |
| PSA | 13.59000 |
| LogP | 5.21620 |
| Appearance of Characters | Powder | Yellow to orange |
| InChIKey | NSWZEXJQHIXCFL-UHFFFAOYSA-N |
| SMILES | IP(I)(c1ccccc1)(c1ccccc1)c1ccccc1 |
| Storage condition | 2-8°C |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
| Symbol |
GHS05, GHS08 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H314-H317-H334-H361 |
| Precautionary Statements | P261-P280-P305 + P351 + P338-P310 |
| Personal Protective Equipment | Eyeshields;Faceshields;full-face particle respirator type N100 (US);Gloves;respirator cartridge type N100 (US);type P1 (EN143) respirator filter;type P3 (EN 143) respirator cartridges |
| Hazard Codes | C |
| Risk Phrases | 34-42/43-62 |
| Safety Phrases | 26-36/37/39-45 |
| RIDADR | UN 2923 8/PG 2 |
| WGK Germany | 3 |
| RTECS | TB6100000 |
|
~97%
diiodotriphenyl... CAS#:6396-07-2 |
| Literature: Grunenthal GMBH Patent: US2009/247505 A1, 2009 ; Location in patent: Page/Page column 15 ; US 20090247505 A1 |
|
~86%
diiodotriphenyl... CAS#:6396-07-2 |
| Literature: Romanenko, V. D.; Tovstenko, V. I.; Markovski, L. N. Synthesis, 1980 , # 10 p. 823 - 825 |
|
~%
diiodotriphenyl... CAS#:6396-07-2 |
| Literature: J. Gen. Chem. USSR (Engl. Transl.), , vol. 49, # 11 p. 2452 - 2458,2165 - 2169 |
|
~%
diiodotriphenyl... CAS#:6396-07-2 |
| Literature: Justus Liebigs Annalen der Chemie, , vol. 562, p. 187,190, 192 |
|
~%
diiodotriphenyl... CAS#:6396-07-2 |
| Literature: Justus Liebigs Annalen der Chemie, , vol. 562, p. 187,190, 192 |
|
~%
diiodotriphenyl... CAS#:6396-07-2 |
| Literature: J. Gen. Chem. USSR (Engl. Transl.), , vol. 54, # 6 p. 1245 - 1251,1114 - 1119 |
|
~%
diiodotriphenyl... CAS#:6396-07-2 |
| Literature: Synthesis, , p. 823 |
| Precursor 7 | |
|---|---|
| DownStream 3 | |
| MFCD00216568 |
| Iodotriphenylphosphoranium iodide |
| Diiodotriphenylphosphorane |
| triphenylphosphine diiodide |
| Triphenylphosphin-diiodid |
| Diiod-triphenylphosphoran |
| Dijod-triphenyl-phosphoran |
| Phosphorane,diiodotriphenyl |