Valopicitabine dihydrochloride structure
|
Common Name | Valopicitabine dihydrochloride | ||
|---|---|---|---|---|
| CAS Number | 640725-71-9 | Molecular Weight | 429.30 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H26Cl2N4O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Valopicitabine dihydrochlorideValopicitabine (NM283) dihydrochloride is a nucleoside analog and the orally bioavailable prodrug of the potent anti-HCV agent 2'-C-methylcytidine (NM107). NM107competitively inhibits NS5B polymerase, causing chain termination[1][2]. |
| Name | [(2R,3R,4R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-4-hydroxy-2-(hydroxymethyl)-4-methyloxolan-3-yl] (2S)-2-amino-3-methylbutanoate,dihydrochloride |
|---|---|
| Synonym | More Synonyms |
| Description | Valopicitabine (NM283) dihydrochloride is a nucleoside analog and the orally bioavailable prodrug of the potent anti-HCV agent 2'-C-methylcytidine (NM107). NM107competitively inhibits NS5B polymerase, causing chain termination[1][2]. |
|---|---|
| Related Catalog | |
| In Vivo | Valopicitabine (NM283) (100 mg/kg; oral administration; Sprague-Dawley Rats) dihydrochloride shows the Cmax, AUC, t1/2, and tmax were 3.624 μg/mL, 8.95 μg h/mL, 0.64 hours and 1 hour, respectively[2]. |
| References |
| Molecular Formula | C15H26Cl2N4O6 |
|---|---|
| Molecular Weight | 429.30 |
| Exact Mass | 428.12300 |
| PSA | 163.91000 |
| LogP | 1.00800 |
| InChIKey | XENHXZMAOSTXGD-DSMKLBDQSA-N |
| SMILES | CC(C)C(N)C(=O)OC1C(CO)OC(n2ccc(N)nc2=O)C1(C)O.Cl.Cl |
| Valopicitabine dihydrochloride |
| NM283 |