5,6,7,15-tetrahydroxy-17-methoxy-11-methyl-12-oxabicyclo[12.4.0]octadeca-1(14),2,8,15,17-pentaen-13-one structure
|
Common Name | 5,6,7,15-tetrahydroxy-17-methoxy-11-methyl-12-oxabicyclo[12.4.0]octadeca-1(14),2,8,15,17-pentaen-13-one | ||
|---|---|---|---|---|
| CAS Number | 66018-41-5 | Molecular Weight | 364.39000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H24O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of 5,6,7,15-tetrahydroxy-17-methoxy-11-methyl-12-oxabicyclo[12.4.0]octadeca-1(14),2,8,15,17-pentaen-13-oneLL-Z1640-4 is a potent p38/JNK signaling inhibitor. LL-Z1640-4 significantly diminishes p38 and JNK activation in HCC cells transfected with MLK4 siRNA. LL-Z1640-4 markedly attenuates ROS production induced by MLK4 knockdown. LL-Z1640-4 significantly reduces the apoptotic cells in HCC cells transfected with siMLK4[1][2]. |
| Name | 5,6,7,15-tetrahydroxy-17-methoxy-11-methyl-12-oxabicyclo[12.4.0]octadeca-1(14),2,8,15,17-pentaen-13-one |
|---|---|
| Synonym | More Synonyms |
| Description | LL-Z1640-4 is a potent p38/JNK signaling inhibitor. LL-Z1640-4 significantly diminishes p38 and JNK activation in HCC cells transfected with MLK4 siRNA. LL-Z1640-4 markedly attenuates ROS production induced by MLK4 knockdown. LL-Z1640-4 significantly reduces the apoptotic cells in HCC cells transfected with siMLK4[1][2]. |
|---|---|
| Related Catalog | |
| In Vitro | LL-Z1640-4 markedly restores the number of cells in migration and invasion decreased by siMLK4, and significantly up-regulates expression of MMP2 and Vimentin[2]. |
| References |
| Molecular Formula | C19H24O7 |
|---|---|
| Molecular Weight | 364.39000 |
| Exact Mass | 364.15200 |
| PSA | 116.45000 |
| LogP | 1.39200 |
| InChIKey | BPOLRDGTYHVUAY-UHFFFAOYSA-N |
| SMILES | COc1cc(O)c2c(c1)C=CCC(O)C(O)C(O)C=CCC(C)OC2=O |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| Antibiotic LL Z1640-4 |