Melatonin D5 structure
|
Common Name | Melatonin D5 | ||
|---|---|---|---|---|
| CAS Number | 66521-38-8 | Molecular Weight | 236.30300 | |
| Density | 1.196g/cm3 | Boiling Point | 512.831ºC at 760 mmHg | |
| Molecular Formula | C13H12D4N2O2 | Melting Point | 117-118ºC | |
| MSDS | N/A | Flash Point | 263.951ºC | |
Use of Melatonin D5Melatonin D5 is deuterium labeled Melatonin. Melatonin is a hormone made by the pineal gland that can activates melatonin receptor. Antioxidative and anti-inflammatory properties[1][2][3]. Melatonin is a selective ATF-6 inhibitor and induces human hepatoma cell apoptosis through COX-2 downregulation[4]. |
| Name | Melatonin-d4 |
|---|---|
| Synonym | More Synonyms |
| Description | Melatonin D5 is deuterium labeled Melatonin. Melatonin is a hormone made by the pineal gland that can activates melatonin receptor. Antioxidative and anti-inflammatory properties[1][2][3]. Melatonin is a selective ATF-6 inhibitor and induces human hepatoma cell apoptosis through COX-2 downregulation[4]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.196g/cm3 |
|---|---|
| Boiling Point | 512.831ºC at 760 mmHg |
| Melting Point | 117-118ºC |
| Molecular Formula | C13H12D4N2O2 |
| Molecular Weight | 236.30300 |
| Flash Point | 263.951ºC |
| Exact Mass | 236.14600 |
| PSA | 54.12000 |
| LogP | 2.24600 |
| Index of Refraction | 1.6 |
| InChIKey | DRLFMBDRBRZALE-NZLXMSDQSA-N |
| SMILES | COc1ccc2[nH]cc(CCNC(C)=O)c2c1 |
| Storage condition | -20C |
| N-[1,1,2,2-tetradeuterio-2-(5-methoxy-1H-indol-3-yl)ethyl]acetamide |