Ansamitocin P-3 structure
|
Common Name | Ansamitocin P-3 | ||
|---|---|---|---|---|
| CAS Number | 66547-09-9 | Molecular Weight | 635.145 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 833.1±65.0 °C at 760 mmHg | |
| Molecular Formula | C32H43ClN2O9 | Melting Point | 182-185℃ | |
| MSDS | N/A | Flash Point | 457.7±34.3 °C | |
Use of Ansamitocin P-3Ansamitocin P 3' exhibits antitumour activity, is an antibody drug conjugate cytotoxin. The more information please refer to Ansamitocin P-3 (HY-15739). |
| Name | Ansamitocin P-3' |
|---|---|
| Synonym | More Synonyms |
| Description | Ansamitocin P 3' exhibits antitumour activity, is an antibody drug conjugate cytotoxin. The more information please refer to Ansamitocin P-3 (HY-15739). |
|---|---|
| Related Catalog | |
| References |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 833.1±65.0 °C at 760 mmHg |
| Melting Point | 182-185℃ |
| Molecular Formula | C32H43ClN2O9 |
| Molecular Weight | 635.145 |
| Flash Point | 457.7±34.3 °C |
| Exact Mass | 634.265686 |
| PSA | 136.16000 |
| LogP | 5.09 |
| Vapour Pressure | 0.0±3.2 mmHg at 25°C |
| Index of Refraction | 1.583 |
| InChIKey | WLKHTIAFMSHJLG-OQPBHURPSA-N |
| SMILES | CCCC(=O)OC1CC(=O)N(C)c2cc(cc(OC)c2Cl)CC(C)=CC=CC(OC)C2(O)CC(OC(=O)N2)C(C)C2OC12C |
| Storage condition | 2-8°C |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
| Hazard Codes | Xn |
|---|---|
| Risk Phrases | R20/22;R36/37/38 |
| Safety Phrases | S26;S36 |
| WGK Germany | 3 |
| RTECS | OQ2293000 |
|
~54%
Ansamitocin P-3 CAS#:66547-09-9 |
| Literature: Kawai; Akimoto; Kozai; et al. Chemical and Pharmaceutical Bulletin, 1984 , vol. 32, # 9 p. 3441 - 3451 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| maytansinol 3-butyrate |
| Propanoic acid, 2-methyl-, (1S,2R,3S,5S,6S,16E,18E,20R,21S)-11-chloro-21-hydroxy-12,20-dimethoxy-2,5,9,16-tetramethyl-8,23-dioxo-4,24-dioxa-9,22-diazatetracyclo[19.3.1.1.0]hexacosa-10,12,1
 4(26),16,18-pentaen-6-yl ester |
| C32H43ClN2O9 |
| Maytansinol butyrate |
| (1S,2R,3S,5S,6S,16E,18E,20R,21S)-11-Chloro-21-hydroxy-12,20-dimethoxy-2,5,9,16-tetramethyl-8,23-dioxo-4,24-dioxa-9,22-diazatetracyclo[19.3.1.1.0]hexacosa-10(26),11,13,16,18-pentaen-6-yl 2- methylpropanoate |
| Ansamitocin P-3 |
| MFCD00274586 |
| Ansamitocin P 3' |