ethyl 2-tributylstannylacetate structure
|
Common Name | ethyl 2-tributylstannylacetate | ||
|---|---|---|---|---|
| CAS Number | 681-94-7 | Molecular Weight | 377.14100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H34O2Sn | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | ethyl 2-tributylstannylacetate |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C16H34O2Sn |
|---|---|
| Molecular Weight | 377.14100 |
| Exact Mass | 378.15800 |
| PSA | 9.23000 |
| LogP | 5.40560 |
| InChIKey | FZSMFBPOVGYFEA-UHFFFAOYSA-N |
| SMILES | CCCC[Sn](CCCC)(CCCC)CC(=O)OCC |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 9 | |
|---|---|
| DownStream 10 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| tributylstannanylacetic acid ethyl ester |
| Bu3SnCH2CO2Et |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What are the downstream products of ethyl 2-tributylstannylacetate? |
| A: Related downstream products(CAS) of ethyl 2-tributylstannylacetate: 5764-85-2;5445-26-1;40291-39-2;40061-55-0;4342-36-3;40061-54-9;595-90-4;1064-10-4;688-73-3;813-19-4. |
| Q: What is the polar surface area (PSA) of ethyl 2-tributylstannylacetate? |
| A: Polar surface area (PSA) of ethyl 2-tributylstannylacetate is 9.23000. |
| Q: What is the SMILES notation of ethyl 2-tributylstannylacetate? |
| A: SMILES notation of ethyl 2-tributylstannylacetate is CCCC[Sn](CCCC)(CCCC)CC(=O)OCC. |
| Q: What are the upstream materials of ethyl 2-tributylstannylacetate? |
| A: Related upstream materials(CAS) of ethyl 2-tributylstannylacetate: 4071-88-9;1067-52-3;1461-22-9;463-51-4;682-00-8;688-73-3;623-73-4;31126-38-2;31126-39-3. |
| Q: What is the English name of ethyl 2-tributylstannylacetate? |
| A: The English name of ethyl 2-tributylstannylacetate is ethyl 2-tributylstannylacetate. |
| Q: What is the molecular weight of ethyl 2-tributylstannylacetate? |
| A: Molecular weight of ethyl 2-tributylstannylacetate is 377.14100. |
| Q: What English synonyms does ethyl 2-tributylstannylacetate have? |
| A: English synonyms of ethyl 2-tributylstannylacetate: tributylstannanylacetic acid ethyl ester, Bu3SnCH2CO2Et. |
| Q: What is the InChIKey of ethyl 2-tributylstannylacetate? |
| A: InChIKey of ethyl 2-tributylstannylacetate is FZSMFBPOVGYFEA-UHFFFAOYSA-N. |
| Q: What is the molecular formula of ethyl 2-tributylstannylacetate? |
| A: Molecular formula of ethyl 2-tributylstannylacetate is C16H34O2Sn. |
| Q: What is the CAS number of ethyl 2-tributylstannylacetate? |
| A: CAS number of ethyl 2-tributylstannylacetate is 681-94-7. |