Dehydroeburicoic acid structure
|
Common Name | Dehydroeburicoic acid | ||
|---|---|---|---|---|
| CAS Number | 6879-05-6 | Molecular Weight | 468.71100 | |
| Density | 1.07±0.1 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C31H48O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Dehydroeburicoic acidDehydrotrametenolic acid is a sterol isolated from the sclerotium of Poria cocos. Dehydrotrametenolic acid induces apoptosis through caspase-3 pathway. Dehydrotrametenolic acid has anti-tumor activity, anti-inflammatory, anti-diabetic effects[1]. |
| Name | Dehydroeburicoic acid |
|---|---|
| Synonym | More Synonyms |
| Description | Dehydrotrametenolic acid is a sterol isolated from the sclerotium of Poria cocos. Dehydrotrametenolic acid induces apoptosis through caspase-3 pathway. Dehydrotrametenolic acid has anti-tumor activity, anti-inflammatory, anti-diabetic effects[1]. |
|---|---|
| Related Catalog | |
| Target |
Caspase-3 |
| In Vivo | Dehydrotrametenolic acid selectively inhibits the growth of H-ras transformed cells with a GI50 value of 40 μM[1]. |
| References |
| Density | 1.07±0.1 g/cm3 |
|---|---|
| Molecular Formula | C31H48O3 |
| Molecular Weight | 468.71100 |
| Exact Mass | 468.36000 |
| PSA | 57.53000 |
| LogP | 7.56580 |
| InChIKey | ONFPYGOMAADWAT-OXUZYLMNSA-N |
| SMILES | C=C(CCC(C(=O)O)C1CCC2(C)C3=CCC4C(C)(CCC(O)C4(C)C)C3=CCC12C)C(C)C |
| Water Solubility | Insuluble (6.1E-6 g/L) (25 ºC) |
| (R)-2-((3S,5R,10S,13R,14R,17R)-3-Hydroxy-4,4,10,13,14-pentamethyl-2,3,4,5,6,10,12,13,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl)-6-methyl-5-methylene-heptanoic acid |
| 3β-Hydroxy-eburica-7,9(11),24(28)-trien-21-saeure |
| dehydroeburicoic acid |
| 3β-Hydroxy-24-methylen-lanosta-7,9(11)-dien-21-saeure |
| 3β-hydroxy-eburica-7,9(11),24(28)-trien-21-oic acid |