Tris(1,1,1,3,3,3-hexafluoro-2-propanyl) borate structure
|
Common Name | Tris(1,1,1,3,3,3-hexafluoro-2-propanyl) borate | ||
|---|---|---|---|---|
| CAS Number | 6919-80-8 | Molecular Weight | 511.901 | |
| Density | 1.6±0.1 g/cm3 | Boiling Point | 122.9±40.0 °C at 760 mmHg | |
| Molecular Formula | C9H3BF18O3 | Melting Point | 31 °C | |
| MSDS | N/A | Flash Point | 28.1±27.3 °C | |
| Name | Tris(hexafluoroisopropyl) Borate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.6±0.1 g/cm3 |
|---|---|
| Boiling Point | 122.9±40.0 °C at 760 mmHg |
| Melting Point | 31 °C |
| Molecular Formula | C9H3BF18O3 |
| Molecular Weight | 511.901 |
| Flash Point | 28.1±27.3 °C |
| Exact Mass | 511.988770 |
| PSA | 27.69000 |
| LogP | 10.98 |
| Vapour Pressure | 16.5±0.2 mmHg at 25°C |
| Index of Refraction | 1.276 |
| InChIKey | GCMBIWYUVPAPEG-UHFFFAOYSA-N |
| SMILES | FC(F)(F)C(OB(OC(C(F)(F)F)C(F)(F)F)OC(C(F)(F)F)C(F)(F)F)C(F)(F)F |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2920909090 |
|
~%
Tris(1,1,1,3,3,... CAS#:6919-80-8 |
| Literature: Monatshefte fuer Chemie, , vol. 100, p. 1489 - 1493 |
|
~%
Tris(1,1,1,3,3,... CAS#:6919-80-8 |
| Literature: Chemische Berichte, , vol. 99, p. 1143 - 1148 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2920909090 |
|---|---|
| Summary | 2920909090 esters of other inorganic acids of non-metals (excluding esters of hydrogen halides) and their salts; their halogenated, sulphonated, nitrated or nitrosated derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| MFCD00191615 |
| Tris(1,1,1,3,3,3-hexafluoropropan-2-yl) borate |
| Tris(1,1,1,3,3,3-hexafluoro-2-propanyl) borate |
| tris(1,1,1,2,3,3-hexafluoropropan-2-yl) borate |