DM-PIT-1 structure
|
Common Name | DM-PIT-1 | ||
|---|---|---|---|---|
| CAS Number | 701947-53-7 | Molecular Weight | 345.373 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C16H15N3O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of DM-PIT-1DM-PIT-1 is a specific PIP3 antagonist that disrupts PIP3/Akt PH domain, PIP3/PDK1 PH domain, and PIP3/GRP1 PH domain with IC50 of 27.1 uM, 80.5 uM, and 35.5 uM, respectively. |
| Name | 3,5-dimethyl PIT-1 |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Molecular Formula | C16H15N3O4S |
| Molecular Weight | 345.373 |
| Exact Mass | 345.078339 |
| PSA | 139.27000 |
| LogP | 4.12 |
| Index of Refraction | 1.711 |
| InChIKey | CGWBCAQMXJFWBU-UHFFFAOYSA-N |
| SMILES | Cc1cc(C)cc(C(=O)NC(=S)Nc2cc([N+](=O)[O-])ccc2O)c1 |
| N-{[(2-hydroxy-5-nitrophenyl)amino]carbonothioyl}-3,5-dimethylbenzamide |
| DM-PIT-1 |
| N-(2-hydroxy-5-nitrophenylcarbamothioyl)-3,5-dimethylbenzamide |
| Benzamide, N-[[(2-hydroxy-5-nitrophenyl)amino]thioxomethyl]-3,5-dimethyl- |