2-Amino-4-hydroxypteridine-6-carbaldehyde structure
|
Common Name | 2-Amino-4-hydroxypteridine-6-carbaldehyde | ||
|---|---|---|---|---|
| CAS Number | 712-30-1 | Molecular Weight | 191.15 | |
| Density | 1.9±0.1 g/cm3 | Boiling Point | 489.1ºC at 760 mmHg | |
| Molecular Formula | C7H5N5O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 249.6ºC | |
Use of 2-Amino-4-hydroxypteridine-6-carbaldehyde6-Formylpterin is an inhibitor of Xanthine Oxidase. 6-Formylpterin induces intracellular ROS generation and apoptosis in HL-60 cells. 6-Formylpterin suppresses cell proliferation in PanC-1 cells[1]. |
| Name | 6-formylpterin |
|---|---|
| Synonym | More Synonyms |
| Description | 6-Formylpterin is an inhibitor of Xanthine Oxidase. 6-Formylpterin induces intracellular ROS generation and apoptosis in HL-60 cells. 6-Formylpterin suppresses cell proliferation in PanC-1 cells[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.9±0.1 g/cm3 |
|---|---|
| Boiling Point | 489.1ºC at 760 mmHg |
| Molecular Formula | C7H5N5O2 |
| Molecular Weight | 191.15 |
| Flash Point | 249.6ºC |
| Exact Mass | 191.044327 |
| PSA | 114.88000 |
| LogP | -1.77 |
| Index of Refraction | 1.893 |
| InChIKey | LLJAQDVNMGLRBD-UHFFFAOYSA-N |
| SMILES | Nc1nc2ncc(C=O)nc2c(=O)[nH]1 |
| HS Code | 2933990090 |
|---|
| Precursor 8 | |
|---|---|
| DownStream 5 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|
Name: Cytotoxicity against mouse TG40 cells transfected with MAIT-alpha/betaTCR assessed as...
Source: ChEMBL
Target: N/A
External Id: CHEMBL5324845
|
|
Name: Cytotoxicity against mouse TG40 cells transfected with MAIT-alpha/betaTCR assessed as...
Source: ChEMBL
Target: N/A
External Id: CHEMBL5324846
|
|
Name: Cytotoxicity against human HeLa cells overexpressing MR1 assessed as reduction in cel...
Source: ChEMBL
Target: HeLa
External Id: CHEMBL5324843
|
|
Name: Cytotoxicity against human HeLa cells overexpressing MR1 assessed as reduction in cel...
Source: ChEMBL
Target: HeLa
External Id: CHEMBL5324844
|
| 2-amino-4-oxo-1H-pteridine-6-carbaldehyde |
| formylpterin |
| 2-amino-4-hydroxy-6-pteridylcarboxaldehyde |
| 6-formyl-pterin |
| 2-amino-4-oxo-3,4-dihydro-pteridine-6-carbaldehyde |
| Pterin-6-aldehyde |
| 2-Amino-4-hydroxy-6-formylpteridine |
| 2-Amino-4-hydroxypteridine-6-carbaldehyde |
| 2-Amino-4-oxo-1,4-dihydro-6-pteridinecarbaldehyde |
| 2-AMINO-6-FORMYLPTERIDIN-4-ONE |
| 2-amino-3,4-dihydro-4-oxo-6-pteridinecarboxaldehyde |
| 6-Pterinaldehyde |
| 2-amino-4-hydroxypteridine-6-carboxaldehyde |