Benzenemethanol,4-fluoro-a-(4-fluorophenyl)-a-(trifluoromethyl)- structure
|
Common Name | Benzenemethanol,4-fluoro-a-(4-fluorophenyl)-a-(trifluoromethyl)- | ||
|---|---|---|---|---|
| CAS Number | 733-83-5 | Molecular Weight | 288.21300 | |
| Density | 1.382g/cm3 | Boiling Point | 111-114ºC 3mm | |
| Molecular Formula | C14H9F5O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | >110ºC | |
| Name | 2,2,2-trifluoro-1,1-bis(4-fluorophenyl)ethanol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.382g/cm3 |
|---|---|
| Boiling Point | 111-114ºC 3mm |
| Molecular Formula | C14H9F5O |
| Molecular Weight | 288.21300 |
| Flash Point | >110ºC |
| Exact Mass | 288.05700 |
| PSA | 20.23000 |
| LogP | 3.76300 |
| Index of Refraction | 1.504 |
| InChIKey | FLLLTDUIYQQQQP-UHFFFAOYSA-N |
| SMILES | OC(c1ccc(F)cc1)(c1ccc(F)cc1)C(F)(F)F |
| Hazard Codes | Xi |
|---|---|
| Risk Phrases | R36/37/38 |
| Safety Phrases | 26-36/37/39 |
| HS Code | 2906299090 |
|
~75%
Benzenemethanol... CAS#:733-83-5 |
| Literature: Billard, Thierry; Langlois, Bernard R.; Blond, Gaelle European Journal of Organic Chemistry, 2001 , # 8 p. 1467 - 1471 |
|
~%
Benzenemethanol... CAS#:733-83-5 |
| Literature: Journal of the American Chemical Society, , vol. 77, p. 4164,4167 |
|
~%
Benzenemethanol... CAS#:733-83-5 |
| Literature: Bulletin of the Chemical Society of Japan, , vol. 70, # 6 p. 1403 - 1411 |
| HS Code | 2906299090 |
|---|---|
| Summary | 2906299090 other aromatic alcohols。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
| 1,1-Bis-<4-fluor-phenyl>-2,2,2-trifluor-aethanol |