9H-Purin-6-amine,N-(2-furanylmethyl)-2-hydrazinyl- structure
|
Common Name | 9H-Purin-6-amine,N-(2-furanylmethyl)-2-hydrazinyl- | ||
|---|---|---|---|---|
| CAS Number | 7471-66-1 | Molecular Weight | 245.24100 | |
| Density | 1.75g/cm3 | Boiling Point | 428.5ºC at 760mmHg | |
| Molecular Formula | C10H11N7O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 213ºC | |
| Name | N-(furan-2-ylmethyl)-2-hydrazinyl-7H-purin-6-amine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.75g/cm3 |
|---|---|
| Boiling Point | 428.5ºC at 760mmHg |
| Molecular Formula | C10H11N7O |
| Molecular Weight | 245.24100 |
| Flash Point | 213ºC |
| Exact Mass | 245.10300 |
| PSA | 120.91000 |
| LogP | 1.03880 |
| Index of Refraction | 1.854 |
| InChIKey | HMHKASRWLSCHGE-UHFFFAOYSA-N |
| SMILES | NNc1nc(NCc2ccco2)c2[nH]cnc2n1 |
|
~%
9H-Purin-6-amin... CAS#:7471-66-1 |
| Literature: Breshears et al. Journal of the American Chemical Society, 1959 , vol. 81, p. 3789,3790 |
| N-(furan-2-ylmethyl)-2-hydrazino-7H-purin-6-amine |
| furfuryl-(2-hydrazino-7(9)H-purin-6-yl)-amine |