m-PEG12-NHS ester structure
|
Common Name | m-PEG12-NHS ester | ||
|---|---|---|---|---|
| CAS Number | 756525-94-7 | Molecular Weight | 685.75500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C30H55NO16 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of m-PEG12-NHS esterm-PEG12-NHS ester is a PEG derivative containing an NHS ester. The NHS ester can be used to label the primary amines (-NH2) of proteins, amine-modified oligonucleotides, and other amine-containing molecules. The hydrophilic PEG spacer increases solubility in aqueous media. |
| Name | (2,5-dioxopyrrolidin-1-yl) 3-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C30H55NO16 |
|---|---|
| Molecular Weight | 685.75500 |
| Exact Mass | 685.35200 |
| PSA | 174.44000 |
| InChIKey | ZMXRHHJWXLKMTL-UHFFFAOYSA-N |
| SMILES | COCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCC(=O)ON1C(=O)CCC1=O |
| Storage condition | -20°C |
| Hazard Codes | F+ |
|---|
| AmbotzPEG1890 |
| Methyl-PEG12-NHS Ester |
| N-Succinimidyl 4,7,10,13,16,19,22,25,28,31,34,37-Dodecaoxaoctatriacontanoate |
| 4,7,10,13,16,19,22,25,28,31,34,37-Dodecaoxaoctatriacontanoic Acid N-Succinimidyl Ester |
| M2188 |