H2N-PEG8-CH2CH2COO<sup>t</sup>Bu structure
|
Common Name | H2N-PEG8-CH2CH2COO<sup>t</sup>Bu | ||
|---|---|---|---|---|
| CAS Number | 756526-06-4 | Molecular Weight | 497.62000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C23H47NO10 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of H2N-PEG8-CH2CH2COO<sup>t</sup>BuAmino-PEG8-Boc is a cleavable 8 unit PEG ADC linker used in the synthesis of antibody-drug conjugates (ADCs)[1]. |
| Name | amino-dPEG8.(TM).-t-butyl ester |
|---|---|
| Synonym | More Synonyms |
| Description | Amino-PEG8-Boc is a cleavable 8 unit PEG ADC linker used in the synthesis of antibody-drug conjugates (ADCs)[1]. |
|---|---|
| Related Catalog | |
| Target |
Cleavable |
| In Vitro | ADCs are comprised of an antibody to which is attached an ADC cytotoxin through an ADC linker. |
| References |
| Molecular Formula | C23H47NO10 |
|---|---|
| Molecular Weight | 497.62000 |
| Exact Mass | 497.32000 |
| PSA | 126.16000 |
| LogP | 1.51000 |
| InChIKey | UMJVFHNJPJVDSB-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)CCOCCOCCOCCOCCOCCOCCOCCOCCN |
| Hazard Codes | Xn |
|---|
| H2N-PEG8-CH2CH2COOtBu |
| H2N-PEG8- CH2CH2COOtBu |