(4-amino-3-methyl-phenyl)-bis(4-aminophenyl)methanol
(4-amino-3-methyl-phenyl)-bis(4-aminophenyl)methanol structure
|
Common Name | (4-amino-3-methyl-phenyl)-bis(4-aminophenyl)methanol | ||
|---|---|---|---|---|
| CAS Number | 76-82-4 | Molecular Weight | 319.40000 | |
| Density | 1.26g/cm3 | Boiling Point | 597.7ºC at 760 mmHg | |
| Molecular Formula | C20H21N3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 315.3ºC | |
Summary: (4-amino-3-methylphenyl)-bis(4-aminophenyl)methanol, Chinese name: (4-氨基-3-甲苯基)-双(4-氨苯基)甲醇, CAS number: 76-82-4, molecular formula: C20H21N3O, molecular weight: 319.40000. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (4-amino-3-methylphenyl)-bis(4-aminophenyl)methanol |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.26g/cm3 |
|---|---|
| Boiling Point | 597.7ºC at 760 mmHg |
| Molecular Formula | C20H21N3O |
| Molecular Weight | 319.40000 |
| Flash Point | 315.3ºC |
| Exact Mass | 319.16800 |
| PSA | 98.29000 |
| LogP | 4.76940 |
| Index of Refraction | 1.706 |
| InChIKey | OYHZNLZYIRSDHN-UHFFFAOYSA-N |
| SMILES | Cc1cc(C(O)(c2ccc(N)cc2)c2ccc(N)cc2)ccc1N |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 9 | |
|---|---|
| DownStream 6 | |
CAS#:142-04-1
CAS#:95-68-1
CAS#:106-49-0
CAS#:95-53-4
CAS#:63861-53-0
CAS#:7732-18-5
CAS#:14337-01-0
CAS#:57-09-0
CAS#:151-21-3
CAS#:611-98-3
CAS#:611-99-4
CAS#:121125-68-6
CAS#:7664-41-7
CAS#:108-95-2This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| Fuchsin-Leukobase |
| Triamino-diphenyl-tolylcarbinol |
| C.I. Basic Violet 14,carbinol |
| 4.4'.4''-Triamino-3-methyl-triphenylcarbinol |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of (4-amino-3-methylphenyl)-bis(4-aminophenyl)methanol? |
| A: CAS number of (4-amino-3-methylphenyl)-bis(4-aminophenyl)methanol is 76-82-4. |
| Q: What is the molecular formula of (4-amino-3-methylphenyl)-bis(4-aminophenyl)methanol? |
| A: Molecular formula of (4-amino-3-methylphenyl)-bis(4-aminophenyl)methanol is C20H21N3O. |
| Q: What is the SMILES notation of (4-amino-3-methylphenyl)-bis(4-aminophenyl)methanol? |
| A: SMILES notation of (4-amino-3-methylphenyl)-bis(4-aminophenyl)methanol is Cc1cc(C(O)(c2ccc(N)cc2)c2ccc(N)cc2)ccc1N. |
| Q: What are the downstream products of (4-amino-3-methylphenyl)-bis(4-aminophenyl)methanol? |
| A: Related downstream products(CAS) of (4-amino-3-methylphenyl)-bis(4-aminophenyl)methanol: 611-98-3;95-53-4;611-99-4;121125-68-6;7664-41-7;108-95-2. |
| Q: What is the boiling point of (4-amino-3-methylphenyl)-bis(4-aminophenyl)methanol? |
| A: Boiling point of (4-amino-3-methylphenyl)-bis(4-aminophenyl)methanol is 597.7ºC at 760 mmHg. |
| Q: What is the LogP of (4-amino-3-methylphenyl)-bis(4-aminophenyl)methanol? |
| A: LogP of (4-amino-3-methylphenyl)-bis(4-aminophenyl)methanol is 4.76940. |
| Q: What is the polar surface area (PSA) of (4-amino-3-methylphenyl)-bis(4-aminophenyl)methanol? |
| A: Polar surface area (PSA) of (4-amino-3-methylphenyl)-bis(4-aminophenyl)methanol is 98.29000. |
| Q: What is the InChIKey of (4-amino-3-methylphenyl)-bis(4-aminophenyl)methanol? |
| A: InChIKey of (4-amino-3-methylphenyl)-bis(4-aminophenyl)methanol is OYHZNLZYIRSDHN-UHFFFAOYSA-N. |
| Q: What English synonyms does (4-amino-3-methylphenyl)-bis(4-aminophenyl)methanol have? |
| A: English synonyms of (4-amino-3-methylphenyl)-bis(4-aminophenyl)methanol: Fuchsin-Leukobase, Triamino-diphenyl-tolylcarbinol, C.I. Basic Violet 14,carbinol, 4.4'.4''-Triamino-3-methyl-triphenylcarbinol. |
| Q: What is the English name of (4-amino-3-methylphenyl)-bis(4-aminophenyl)methanol? |
| A: The English name of (4-amino-3-methylphenyl)-bis(4-aminophenyl)methanol is (4-amino-3-methylphenyl)-bis(4-aminophenyl)methanol. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |