Enalaprilat structure
|
Common Name | Enalaprilat | ||
|---|---|---|---|---|
| CAS Number | 76420-72-9 | Molecular Weight | 348.39400 | |
| Density | 1.286 g/cm3 (20ºC) | Boiling Point | 601ºC at 760 mmHg | |
| Molecular Formula | C18H24N2O5 | Melting Point | 148-151°C | |
| MSDS | Chinese USA | Flash Point | 317.3ºC | |
Use of EnalaprilatEnalaprilat (MK-422 anhydrous), the active metabolite of the oral prodrug Enalapril, is a potent, competitive and long-acting angiotensin-converting enzyme (ACE) inhibitor, with an IC50 of 1.94 nM. Enalaprilat can be used for the research of hypertension[1][2][3]. |
| Name | enalaprilat (anhydrous) |
|---|---|
| Synonym | More Synonyms |
| Description | Enalaprilat (MK-422 anhydrous), the active metabolite of the oral prodrug Enalapril, is a potent, competitive and long-acting angiotensin-converting enzyme (ACE) inhibitor, with an IC50 of 1.94 nM. Enalaprilat can be used for the research of hypertension[1][2][3]. |
|---|---|
| Related Catalog | |
| Target |
IC50: 1.94 nM (ACE)[1] |
| In Vitro | Enalaprilat (1 nM-10 μM; 24 h) attenuates the IGF-I induced neonatal rat cardiac fibroblast growth (30% reduction) in a concentration-dependent fashion, with an IC50 of 90 mM[2]. |
| In Vivo | Enalaprilat (0.01%-2.9% in the eyedrop solution) shows significant intraocular pressure (IOP)-lowering effect in rabbits[3]. |
| References |
| Density | 1.286 g/cm3 (20ºC) |
|---|---|
| Boiling Point | 601ºC at 760 mmHg |
| Melting Point | 148-151°C |
| Molecular Formula | C18H24N2O5 |
| Molecular Weight | 348.39400 |
| Flash Point | 317.3ºC |
| Exact Mass | 348.16900 |
| PSA | 106.94000 |
| LogP | 1.45490 |
| InChIKey | LZFZMUMEGBBDTC-QEJZJMRPSA-N |
| SMILES | CC(NC(CCc1ccccc1)C(=O)O)C(=O)N1CCCC1C(=O)O |
| Hazard Codes | Xn |
|---|---|
| Risk Phrases | R68:Possible risk of irreversible effects. |
| Safety Phrases | S22-S36/37/39 |
| RTECS | DU9085000 |
| HS Code | 2933990090 |
| Precursor 10 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Vasotec IV |
| MFCD08060099 |
| ENALAPRILAT HYDRATE |
| L-Proline,1-[N-(1-carboxy-3-phenylpropyl)-L-alanyl]-,(S) |
| S-1-[N-(1-carboxy-3-phenylpropyl)-L-alanyl]-L-proline |
| ENALAPRILAT USP(CRM STANDARD) |
| Enalaprilat |
| Enalapril acid |
| Enalaprilic Acid |
| 1-[N-[(S)-1-Carboxy-3-phenylpropyl]-L-alanyl]-L-proline |
| N-(1(S)-carboxy-3-phenylpropyl)-L-alanyl-L-proline |
| enalaprilate |
| Enalapril diacid |
| EINECS 278-459-3 |