SNAP structure
|
Common Name | SNAP | ||
|---|---|---|---|---|
| CAS Number | 79032-48-7 | Molecular Weight | 220.25 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C7H12N2O4S | Melting Point | 150-151ºC | |
| MSDS | N/A | Flash Point | N/A | |
Use of SNAPD-SNAP (S-Nitroso-N-acetylpenicillamine) can Generate nitric oxide and form superoxides spontaneously under physiological conditions and is often used to probe the cell stress response and stimulate calcium-independent synaptic vesicle release. |
| Name | S-nitroso-N-acetyl-D-penicillamine |
|---|---|
| Synonym | More Synonyms |
| Description | D-SNAP (S-Nitroso-N-acetylpenicillamine) can Generate nitric oxide and form superoxides spontaneously under physiological conditions and is often used to probe the cell stress response and stimulate calcium-independent synaptic vesicle release. |
|---|---|
| Related Catalog |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Melting Point | 150-151ºC |
| Molecular Formula | C7H12N2O4S |
| Molecular Weight | 220.25 |
| Exact Mass | 220.051773 |
| PSA | 121.13000 |
| LogP | 1.13 |
| Index of Refraction | 1.560 |
| InChIKey | ZIIQCSMRQKCOCT-YFKPBYRVSA-N |
| SMILES | CC(=O)NC(C(=O)O)C(C)(C)SN=O |
| Hazard Codes | Xi: Irritant; |
|---|---|
| Risk Phrases | R36/37/38 |
| Safety Phrases | 26-36 |
| HS Code | 2930909090 |
|
~68%
SNAP CAS#:79032-48-7 |
| Literature: Choi, Lai-Sheung; Bayley, Hagan Angewandte Chemie - International Edition, 2012 , vol. 51, # 32 p. 7972 - 7976 |
|
~%
SNAP CAS#:79032-48-7 |
| Literature: Wang, Kun; Wen, Zhong; Zhang, Wei; Xian, Ming; Cheng, Jin-Pei; Wang, Peng George Bioorganic and Medicinal Chemistry Letters, 2001 , vol. 11, # 3 p. 433 - 436 |
| HS Code | 2930909090 |
|---|---|
| Summary | 2930909090. other organo-sulphur compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| N-(ACETYLOXY)-3-NITROSOTHIOVALINE |
| S-nitroso-acetyl-DL-penicillinamine |
| N-Acetyl-3-(nitrosothio)-DL-valine |
| N-acetyl-S-nitroso-D-penicillamine |
| S-nitroso-N-acetyl-d,l-penicillamine |
| N-Acetyl-S-nitrosopenicillamine |
| (+/-)-S-NITROSO-N-ACETYLPENICILLAMINE |
| N-Acetyl-3-(nitrososulfanyl)valine |
| S-nitroso-N-acetyl-DL-pencillamine |
| Valine, N-acetyl-3-(nitrosothio)- |
| snap |