(4-Methyl-3-nitrophenyl)boronic acid structure
|
Common Name | (4-Methyl-3-nitrophenyl)boronic acid | ||
|---|---|---|---|---|
| CAS Number | 80500-27-2 | Molecular Weight | 180.954 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 356.7±52.0 °C at 760 mmHg | |
| Molecular Formula | C7H8BNO4 | Melting Point | 265-270ºC(lit.) | |
| MSDS | Chinese USA | Flash Point | 169.5±30.7 °C | |
| Name | (4-methyl-3-nitrophenyl)boronic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 356.7±52.0 °C at 760 mmHg |
| Melting Point | 265-270ºC(lit.) |
| Molecular Formula | C7H8BNO4 |
| Molecular Weight | 180.954 |
| Flash Point | 169.5±30.7 °C |
| Exact Mass | 181.054642 |
| PSA | 86.28000 |
| LogP | 1.78 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Index of Refraction | 1.564 |
| InChIKey | OASVXBRTNVFKFS-UHFFFAOYSA-N |
| SMILES | Cc1ccc(B(O)O)cc1[N+](=O)[O-] |
| Storage condition | 2-8°C |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| Hazard Codes | Xi: Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2931900090 |
|
~75%
(4-Methyl-3-nit... CAS#:80500-27-2 |
| Literature: Journal of the American Chemical Society, , vol. 54, p. 4415 - 4424 |
|
~%
(4-Methyl-3-nit... CAS#:80500-27-2 |
| Literature: Journal of the American Chemical Society, , vol. 54, p. 4415,4418 |
|
~%
(4-Methyl-3-nit... CAS#:80500-27-2 |
| Literature: Journal of the American Chemical Society, , vol. 54, p. 4415,4418 |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| 4-methyl-3-nitrobenzeneboronic acid |
| 4-methyl-3-nitro-phenyl boronic acid |
| 3-Nitro-p-tolylboronic Acid |
| MFCD00191550 |
| (4-Methyl-3-nitrophenyl)boronic acid |
| 3-nitro-4-methylbenzeneboronic acid |
| 3-nitro-4-methylphenyl boronic acid |