4-Amino-3-nitrophenylboronicacid structure
|
Common Name | 4-Amino-3-nitrophenylboronicacid | ||
|---|---|---|---|---|
| CAS Number | 89466-07-9 | Molecular Weight | 181.94200 | |
| Density | 1.48g/cm3 | Boiling Point | 439.5ºC at 760 mmHg | |
| Molecular Formula | C6H7BN2O4 | Melting Point | 215-225ºC (dec.) | |
| MSDS | Chinese USA | Flash Point | 219.6ºC | |
| Name | 4-Amino-3-nitrophenylboronic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.48g/cm3 |
|---|---|
| Boiling Point | 439.5ºC at 760 mmHg |
| Melting Point | 215-225ºC (dec.) |
| Molecular Formula | C6H7BN2O4 |
| Molecular Weight | 181.94200 |
| Flash Point | 219.6ºC |
| Exact Mass | 182.05000 |
| PSA | 112.30000 |
| Index of Refraction | 1.617 |
| InChIKey | IRTXQNNJQZNKRP-UHFFFAOYSA-N |
| SMILES | Nc1ccc(B(O)O)cc1[N+](=O)[O-] |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| Hazard Codes | Xi |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
|
~%
4-Amino-3-nitro... CAS#:89466-07-9 |
| Literature: Arkiv foer Kemi, , vol. 10, p. 497,503 |
|
~%
4-Amino-3-nitro... CAS#:89466-07-9 |
| Literature: Arkiv foer Kemi, , vol. 10, p. 497,503 |
|
~%
4-Amino-3-nitro... CAS#:89466-07-9 |
| Literature: Arkiv foer Kemi, , vol. 10, p. 497,503 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| (4-amino-3-nitrophenyl)boronic acid |
| MFCD07437851 |