4-Borono-2-nitrobenzoic acid structure
|
Common Name | 4-Borono-2-nitrobenzoic acid | ||
|---|---|---|---|---|
| CAS Number | 80500-28-3 | Molecular Weight | 210.93700 | |
| Density | 1.62g/cm3 | Boiling Point | 475.5ºC at 760 mmHg | |
| Molecular Formula | C7H6BNO6 | Melting Point | 220°C(lit.) | |
| MSDS | N/A | Flash Point | 241.4ºC | |
| Name | 4-Borono-2-nitrobenzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.62g/cm3 |
|---|---|
| Boiling Point | 475.5ºC at 760 mmHg |
| Melting Point | 220°C(lit.) |
| Molecular Formula | C7H6BNO6 |
| Molecular Weight | 210.93700 |
| Flash Point | 241.4ºC |
| Exact Mass | 211.02900 |
| PSA | 123.58000 |
| Index of Refraction | 1.619 |
| InChIKey | APQGIZKNZHGXTG-UHFFFAOYSA-N |
| SMILES | O=C(O)c1ccc(B(O)O)cc1[N+](=O)[O-] |
| Hazard Codes | Xi |
|---|
|
~79%
4-Borono-2-nitr... CAS#:80500-28-3 |
| Literature: Tondi, Donatella; Calo, Samuele; Shoichet, Brian K.; Costi, Maria Paola Bioorganic and Medicinal Chemistry Letters, 2010 , vol. 20, # 11 p. 3416 - 3419 |
| Precursor 1 | |
|---|---|
| DownStream 2 | |
| MFCD10696661 |