Taurocholic Acid structure
|
Common Name | Taurocholic Acid | ||
|---|---|---|---|---|
| CAS Number | 81-24-3 | Molecular Weight | 571.81 | |
| Density | 1.265g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C30H53NO7S | Melting Point | 125°C (rough estimate) | |
| MSDS | N/A | Flash Point | N/A | |
Use of Taurocholic AcidTaurocholic acid is a bile acid involved in the emulsification of fats. |
| Name | Taurocholic Acid |
|---|---|
| Synonym | More Synonyms |
| Description | Taurocholic acid is a bile acid involved in the emulsification of fats. |
|---|---|
| Related Catalog | |
| Target |
Human Endogenous Metabolite |
| In Vivo | The bile acid Taurocholic acid (TCA) exerts permeation enhancing effects in vivo[1]. |
| References |
| Density | 1.265g/cm3 |
|---|---|
| Melting Point | 125°C (rough estimate) |
| Molecular Formula | C30H53NO7S |
| Molecular Weight | 571.81 |
| PSA | 152.54000 |
| LogP | 3.83980 |
| Index of Refraction | 1.565 |
| InChIKey | WBWWGRHZICKQGZ-HZAMXZRMSA-N |
| SMILES | CC(CCC(=O)NCCS(=O)(=O)O)C1CCC2C3C(O)CC4CC(O)CCC4(C)C3CC(O)C12C |
| Precursor 0 | |
|---|---|
| DownStream 1 | |
| 2-[[(4R)-4-[(3R,5S,7R,8R,9S,10S,12S,13R,14S,17R)-3,7,12-trihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoyl]amino]ethanesulfonic acid |
| Cholyltaurine |
| EINECS 201-336-2 |