Himic anhydride structure
|
Common Name | Himic anhydride | ||
|---|---|---|---|---|
| CAS Number | 826-62-0 | Molecular Weight | 164.158 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 331.1±42.0 °C at 760 mmHg | |
| Molecular Formula | C9H8O3 | Melting Point | 158-164ºC | |
| MSDS | Chinese USA | Flash Point | 163.8±25.1 °C | |
| Symbol |
GHS05, GHS08 |
Signal Word | Danger | |
| Name | 5-Norbornene-2,3-Dicarboxylic Anhydride |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 331.1±42.0 °C at 760 mmHg |
| Melting Point | 158-164ºC |
| Molecular Formula | C9H8O3 |
| Molecular Weight | 164.158 |
| Flash Point | 163.8±25.1 °C |
| Exact Mass | 164.047348 |
| PSA | 43.37000 |
| LogP | -0.04 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.584 |
| InChIKey | KNDQHSIWLOJIGP-UHFFFAOYSA-N |
| SMILES | O=C1OC(=O)C2C3C=CC(C3)C12 |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
| Symbol |
GHS05, GHS08 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H317-H318-H334 |
| Precautionary Statements | P261-P280-P305 + P351 + P338-P342 + P311 |
| Hazard Codes | Xn:Harmful; |
| Risk Phrases | R41;R42/43 |
| Safety Phrases | S22-S24-S26-S37/39 |
| RIDADR | UN 1325 |
| WGK Germany | 3 |
| RTECS | DT5600000 |
| Packaging Group | I; II; III |
| HS Code | 2932999099 |
| Precursor 10 | |
|---|---|
| DownStream 6 | |
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|
[Synthetic transformations of higher terpenoids. XXVI. 16-Acetylaminomethyllabdanoids and theirs cytotoxicity].
Bioorg. Khim. 38(1) , 127-36, (2012) Condensation of methyl 16-aminomethyllambertianate with N-Boc-omega-amino acids leads smoothly to 16-(N-Boc-aminononan)- and 16-(N-Boc-aminoundecan)amidomethyllabdanoids. The amide of bicyclo[2.2.1]he... |
|
|
Phthalide Cardo Chain Extended Siloxane Core Skeletal Modified Polyimide/Multi-Walled Carbon Nanotube Nanocomposites.
J. Nanosci. Nanotechnol. 15 , 6739-46, (2015) A new type of siloxane core modified phthalide cardo chain based polyimide (PI) was successfully prepared from siloxane core dianhydride and ether linked phenolphthalein diamine moiety. This PI was fu... |
| EINECS 212-557-9 |
| Nadic Anhydride |
| 3a,4,7,7a-tetrahydro-4,7-methano-2-benzofuran-1,3-dione |
| cis-endo-5-Norbornene-2,3-dicarboxylic anhydride |
| MFCD00151106 |
| 3,6-Endomethylene-1,2,3,6-tetrabydro-cis-phthalic Anhydride |
| exo-3,6-Methylene-1,2,3,6-tetrahydrophthalic anhydride |
| 4-Oxatricyclo[5.2.1.0]dec-8-ene-3,5-dione |
| Bicyclo[2.2.1]-5-heptene-2,3-dicarboxylic Anhydride |
| 4,7-Methanoisobenzofuran-1,3-dione, 3a,4,7,7a-tetrahydro- |
| 3,6-Endomethylene-D4-tetrahydrophthalic Anhydride |
| 3,6-Endomethylene-δ4-tetrahydrophthalic anhydride |
| 3aa,4,7,7aa-Tetrahydro-4a,7a-methanoisobenzofuran-1,3-dione |
| endo-cis-Bicyclo[2.2.1]hept-5-ene-2,3-dicarboxylic Anhydride |
| Himic anhydride |