diphenylurethane structure
|
Common Name | diphenylurethane | ||
|---|---|---|---|---|
| CAS Number | 603-52-1 | Molecular Weight | 241.28500 | |
| Density | 1.146 g/cm3 | Boiling Point | 360ºC at 760 mmHg | |
| Molecular Formula | C15H15NO2 | Melting Point | 70-72 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 171.5ºC | |
| Name | ethyl N,N-diphenylcarbamate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.146 g/cm3 |
|---|---|
| Boiling Point | 360ºC at 760 mmHg |
| Melting Point | 70-72 °C(lit.) |
| Molecular Formula | C15H15NO2 |
| Molecular Weight | 241.28500 |
| Flash Point | 171.5ºC |
| Exact Mass | 241.11000 |
| PSA | 29.54000 |
| LogP | 3.98120 |
| Index of Refraction | 1.593 |
| InChIKey | HKTSLDUAGCAISP-UHFFFAOYSA-N |
| SMILES | CCOC(=O)N(c1ccccc1)c1ccccc1 |
| Safety Phrases | S22-S24/25 |
|---|---|
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| Precursor 10 | |
|---|---|
| DownStream 10 | |
|
Mass Spectra of N-Substituted Ethyl Carbamates Lewis CP.
Anal. Chem. 36(8) , 1582-88, (1964)
|
|
|
Steric factors in the gas phase elimination kinetics of ethyl N-benzyl-N-cyclopropylcarbamate and ethyl diphenylcarbamate. Luiggi M, et al.
Int. J. Chem. Kinet. 34(1) , 67-71, (2002)
|
| ethoxy-N,N-dibenzamide |
| ethyl diphenylcarbamate |
| EINECS 210-047-0 |
| Diphenylurethan |
| N,N-Diphenylurethane |
| MFCD00026818 |
| diphenyl-carbamic acid ethyl ester |
| Diphenyl-carbamidsaeure-aethylester |
| Diphenylurethane |
| N,N-diphenyl ethylcarbamate |