116-9e structure
|
Common Name | 116-9e | ||
|---|---|---|---|---|
| CAS Number | 831217-43-7 | Molecular Weight | 512.60 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C31H32N2O5 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Symbol |
GHS06, GHS09 |
Signal Word | Danger | |
Use of 116-9e116-9e (MAL2-11B) is a Hsp70 co-chaperone DNAJA1 inhibitor. 116-9e inhibits Simian Virus 40 (SV40) replication and DNA synthesis. 116-9e inhibits tumor antigen (TAg)’s endogenous ATPase activity and the TAg-mediated activation of Hsp70[1][2]. |
| Name | 6-[4-methyl-2-oxo-5-phenylmethoxycarbonyl-6-(4-phenylphenyl)-1,6-dihydropyrimidin-3-yl]hexanoic acid |
|---|---|
| Synonym | More Synonyms |
| Description | 116-9e (MAL2-11B) is a Hsp70 co-chaperone DNAJA1 inhibitor. 116-9e inhibits Simian Virus 40 (SV40) replication and DNA synthesis. 116-9e inhibits tumor antigen (TAg)’s endogenous ATPase activity and the TAg-mediated activation of Hsp70[1][2]. |
|---|---|
| Related Catalog | |
| Target |
Simian Virus 40 (SV40) [1] Hsp70 co-chaperone DNAJA1[2] |
| In Vitro | 116-9e (MAL2-11B) inhibits TAg stimulation of Hsp70 with greater efficacy than MAL3-101, significantly reduces viral replication and DNA synthesis. MAL2-11B also inhibits the activity of the TAg ATPase domain[1]. 116-9e (MAL2-11B; 15 µM; 5 days) significantly reduces the growth of BK virus in a human kidney cell line[1]. |
| References |
| Molecular Formula | C31H32N2O5 |
|---|---|
| Molecular Weight | 512.60 |
| Exact Mass | 512.23100 |
| PSA | 99.43000 |
| LogP | 5.66020 |
| InChIKey | GHFQWLNXJMUCGC-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=O)OCc2ccccc2)C(c2ccc(-c3ccccc3)cc2)NC(=O)N1CCCCCC(=O)O |
| Storage condition | 2-8°C |
| Symbol |
GHS06, GHS09 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H301-H410 |
| Precautionary Statements | P273-P301 + P310-P501 |
| Hazard Codes | T |
| Risk Phrases | 25-50/53 |
| Safety Phrases | 45-60-61 |
| RIDADR | UN 2811 6.1 / PGIII |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| upcmld00wmal2-11b |
| hms2227g12 |
| upcmld00wmal2-11b:004 |
| upcmld00wmal2-11b:002 |
| upcmld00wmal2-11b:003 |