Astragaloside I structure
|
Common Name | Astragaloside I | ||
|---|---|---|---|---|
| CAS Number | 84680-75-1 | Molecular Weight | 869.04 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 910.6±65.0 °C at 760 mmHg | |
| Molecular Formula | C45H72O16 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 265.5±27.8 °C | |
Use of Astragaloside IAstragaloside I is a natural product isolated from Astragalus. |
| Name | 3-O-β-(2',3'-di-O-acetyl)-D-xylopyranosyl-6-O-β-D-glucopyranosyl-cycloastragenol |
|---|---|
| Synonym | More Synonyms |
| Description | Astragaloside I is a natural product isolated from Astragalus. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 910.6±65.0 °C at 760 mmHg |
| Molecular Formula | C45H72O16 |
| Molecular Weight | 869.04 |
| Flash Point | 265.5±27.8 °C |
| PSA | 240.36000 |
| LogP | 0.94 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.603 |
| InChIKey | GBPDDYORNLOZID-BYZJQVIXSA-N |
| SMILES | CC(=O)OC1C(O)COC(OC2CCC34CC35CCC3(C)C(C6(C)CCC(C(C)(C)O)O6)C(O)CC3(C)C5CC(OC3OC(CO)C(O)C(O)C3O)C4C2)C1OC(C)=O |
| Hazard Codes | Xi |
|---|---|
| RIDADR | NONH for all modes of transport |
| Precursor 0 | |
|---|---|
| DownStream 2 | |
| 2,5-Bis[1-(1,1-dimethyl-2-propenyl)-1H-indol-3-yl]-3,6-dimethoxy-2,5-cyclohexadiene-1,4-dione |
| asterriquinone dimethyl ether |
| cyclosiversioside B |
| Astragaloside I |
| 2,5-dimethoxy-3,6-bis[1-(2-methylbut-3-en-2-yl)-1H-indol-3-yl]cyclohexa-2,5-diene-1,4-dione |
| 2,5-bis[1-(1,1-dimethylallyl)-1H-indol-3-yl]-3,6-dimethoxy-1,4-benzoquinone |
| 2,5-bis-[1-(1,1-dimethyl-allyl)-indol-3-yl]-3,6-dimethoxy-[1,4]benzoquinone |
| Asterrichinon-dimethylether |
| asterriquinone A1 |
| β-D-Glucopyranoside, (3β,6α,16β,20R,24S)-3-[(2,3-di-O-acetyl-β-D-xylopyranosyl)oxy]-20,24-epoxy-16,25-dihydroxy-14-methyl-9,19-cyclocholestan-6-yl |
| (3β,6α,16β,20R,24S)-3-[(2,3-Di-O-acetyl-β-D-xylopyranosyl)oxy]-16,25-dihydroxy-14-methyl-20,24-epoxy-9,19-cyclocholestan-6-yl β-D-glucopyranoside |