EP2 receptor antagonist-1 structure
|
Common Name | EP2 receptor antagonist-1 | ||
|---|---|---|---|---|
| CAS Number | 848920-08-1 | Molecular Weight | 446.46 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C24H22N4O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of EP2 receptor antagonist-1EP2 receptor antagonist-1 (compound 1) is a potent, reversible, and agonist dependent allosteric prostaglandin EP2 receptor antagonist. EP2 receptor antagonist-1 shows anti-inflammatory effects[1]. |
| Name | EP2 receptor antagonist-1 |
|---|
| Description | EP2 receptor antagonist-1 (compound 1) is a potent, reversible, and agonist dependent allosteric prostaglandin EP2 receptor antagonist. EP2 receptor antagonist-1 shows anti-inflammatory effects[1]. |
|---|---|
| Related Catalog | |
| Target |
EP2 |
| References |
| Molecular Formula | C24H22N4O5 |
|---|---|
| Molecular Weight | 446.46 |
| InChIKey | OHXALKVNKANGKL-UHFFFAOYSA-N |
| SMILES | Nc1c(C(=O)OCC2CCCO2)c2nc3ccccc3nc2n1-c1ccc2c(c1)OCCO2 |