Boc-Val-Cit-PAB structure
|
Common Name | Boc-Val-Cit-PAB | ||
|---|---|---|---|---|
| CAS Number | 870487-09-5 | Molecular Weight | 479.570 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 771.3±60.0 °C at 760 mmHg | |
| Molecular Formula | C23H37N5O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 420.3±32.9 °C | |
Use of Boc-Val-Cit-PABBoc-Val-Cit-PAB is a cleavable ADC linker used in the synthesis of antibody-drug conjugates (ADCs)[1]. |
| Name | N-{[(2-Methyl-2-propanyl)oxy]carbonyl}-L-valyl-N5-carbamoyl-N-[4-(hydroxymethyl)phenyl]-L-ornithinamide |
|---|---|
| Synonym | More Synonyms |
| Description | Boc-Val-Cit-PAB is a cleavable ADC linker used in the synthesis of antibody-drug conjugates (ADCs)[1]. |
|---|---|
| Related Catalog | |
| Target |
Cleavable |
| In Vitro | ADCs are comprised of an antibody to which is attached an ADC cytotoxin through an ADC linker[1]. |
| References |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 771.3±60.0 °C at 760 mmHg |
| Molecular Formula | C23H37N5O6 |
| Molecular Weight | 479.570 |
| Flash Point | 420.3±32.9 °C |
| Exact Mass | 479.274384 |
| LogP | 0.84 |
| Vapour Pressure | 0.0±2.8 mmHg at 25°C |
| Index of Refraction | 1.558 |
| InChIKey | VYCVAPFXSOAOCL-ROUUACIJSA-N |
| SMILES | CC(C)C(NC(=O)OC(C)(C)C)C(=O)NC(CCCNC(N)=O)C(=O)Nc1ccc(CO)cc1 |
| Storage condition | 2-8°C |
| L-Ornithinamide, N-[(1,1-dimethylethoxy)carbonyl]-L-valyl-N5-(aminocarbonyl)-N-[4-(hydroxymethyl)phenyl]- |
| N-{[(2-Methyl-2-propanyl)oxy]carbonyl}-L-valyl-N5-carbamoyl-N-[4-(hydroxymethyl)phenyl]-L-ornithinamide |