Cinnamtannin B1 structure
|
Common Name | Cinnamtannin B1 | ||
|---|---|---|---|---|
| CAS Number | 88082-60-4 | Molecular Weight | 864.75700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C45H36O18 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Cinnamtannin B1Cinnamtannin B-1 is a proanthocyanidin with multiple biological functions, including antioxidant effects. Cinnamtannin B-1 inhibits RANKL-induced osteoclastogenesis and prevents ovariectomy-induced osteoporosis in vivo[1]. Cinnamtannin B-1 can be used for the research osteoporosis and colon cancers[1][2]. |
| Name | cinnamtannin b-1 |
|---|---|
| Synonym | More Synonyms |
| Description | Cinnamtannin B-1 is a proanthocyanidin with multiple biological functions, including antioxidant effects. Cinnamtannin B-1 inhibits RANKL-induced osteoclastogenesis and prevents ovariectomy-induced osteoporosis in vivo[1]. Cinnamtannin B-1 can be used for the research osteoporosis and colon cancers[1][2]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C45H36O18 |
|---|---|
| Molecular Weight | 864.75700 |
| Exact Mass | 864.19000 |
| PSA | 320.14000 |
| LogP | 4.24240 |
| InChIKey | BYSRPHRKESMCPO-LQNPQWRQSA-N |
| SMILES | Oc1cc(O)c2c(c1)OC1(c3ccc(O)c(O)c3)Oc3cc(O)c4c(c3C2C1O)OC(c1ccc(O)c(O)c1)C(O)C4c1c(O)cc(O)c2c1OC(c1ccc(O)c(O)c1)C(O)C2 |
| Precursor 0 | |
|---|---|
| DownStream 3 | |
| Cinnamtannin B1 |