LY 225910 structure
|
Common Name | LY 225910 | ||
|---|---|---|---|---|
| CAS Number | 133040-77-4 | Molecular Weight | 502.40200 | |
| Density | 1.39g/cm3 | Boiling Point | 690.3ºC at 760mmHg | |
| Molecular Formula | C27H24BrN3O2 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 371.3ºC | |
| Symbol |
GHS06 |
Signal Word | Danger | |
| Name | 2-[2-(5-bromo-1H-indol-3-yl)ethyl]-3-(3-propan-2-yloxyphenyl)quinazolin-4-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.39g/cm3 |
|---|---|
| Boiling Point | 690.3ºC at 760mmHg |
| Molecular Formula | C27H24BrN3O2 |
| Molecular Weight | 502.40200 |
| Flash Point | 371.3ºC |
| Exact Mass | 501.10500 |
| PSA | 59.91000 |
| LogP | 6.20190 |
| Vapour Pressure | 6.59E-19mmHg at 25°C |
| Index of Refraction | 1.667 |
| InChIKey | KUECXUACQOYKNB-UHFFFAOYSA-N |
| SMILES | CC(C)Oc1cccc(-n2c(CCc3c[nH]c4ccc(Br)cc34)nc3ccccc3c2=O)c1 |
| Symbol |
GHS06 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H301-H413 |
| Precautionary Statements | P301 + P310 |
| RIDADR | UN 2811 6.1 / PGIII |
|
~%
LY 225910 CAS#:133040-77-4 |
| Literature: Yu; Thrasher; McCowan; Mason; Mendelsohn Journal of Medicinal Chemistry, 1991 , vol. 34, # 4 p. 1505 - 1508 |
|
~%
LY 225910 CAS#:133040-77-4 |
| Literature: Yu; Thrasher; McCowan; Mason; Mendelsohn Journal of Medicinal Chemistry, 1991 , vol. 34, # 4 p. 1505 - 1508 |
|
~%
LY 225910 CAS#:133040-77-4 |
| Literature: Yu; Thrasher; McCowan; Mason; Mendelsohn Journal of Medicinal Chemistry, 1991 , vol. 34, # 4 p. 1505 - 1508 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| Tocris-1018 |
| 2-[2-(5-Bromo-1H-indol-3-yl)ethyl]-3-[3-(1-methylethoxy )phenyl]-4-(3H)-quinazolinone |
| HMS3267O07 |