Biotin-LC-LC-NHS structure
|
Common Name | Biotin-LC-LC-NHS | ||
|---|---|---|---|---|
| CAS Number | 89889-52-1 | Molecular Weight | 567.698 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C26H41N5O7S | Melting Point | 147-151ºC | |
| MSDS | USA | Flash Point | N/A | |
Use of Biotin-LC-LC-NHSBiotin-LC-LC-NHS is a SMCC cross-linking reagent that can be used to mark antibody and other small molecules, such as Paclitaxel[1][2]. |
| Name | Succinimidyl-6-[6-(biotinamido)caproyl]caproylate |
|---|---|
| Synonym | More Synonyms |
| Description | Biotin-LC-LC-NHS is a SMCC cross-linking reagent that can be used to mark antibody and other small molecules, such as Paclitaxel[1][2]. |
|---|---|
| Related Catalog | |
| In Vitro | Biotinylation of antibodies is accomplished by the reaction of Biotin-LC-LC-NHS (1 mg/mL in dimethyl formamide) with the protein in aqueous phase pH 7.4. The molar ratio of biotin to antibody in the labeling reaction was 10:1 (the final concentration of biotin was 70 μM) [1]. |
| References |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Melting Point | 147-151ºC |
| Molecular Formula | C26H41N5O7S |
| Molecular Weight | 567.698 |
| Exact Mass | 567.272644 |
| PSA | 188.31000 |
| LogP | -1.83 |
| Index of Refraction | 1.579 |
| InChIKey | ATYCFNRXENKXSE-MHPIHPPYSA-N |
| SMILES | O=C(CCCCCNC(=O)CCCCC1SCC2NC(=O)NC21)NCCCCCC(=O)ON1C(=O)CCC1=O |
| RIDADR | NONH for all modes of transport |
|---|---|
| WGK Germany | 3 |
|
~%
Biotin-LC-LC-NHS CAS#:89889-52-1 |
| Literature: US2012/232262 A1, ; |
|
~%
Biotin-LC-LC-NHS CAS#:89889-52-1 |
| Literature: US2012/232262 A1, ; |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
|
Preparation of modified tubulins.
Meth. Enzymol. 196 , 478-485, (1991)
|
|
|
Ligand-based histochemical localization and capture of cells expressing heat-stable enterotoxin receptors.
Mol. Microbiol. 8 , 865-873, (1993) The heat stable enterotoxins (ST) of enterotoxigenic Escherichia coli (ETEC) cause diarrhoea by binding specific intestinal receptors. Precise histochemical localization of ST receptors could provide ... |
| (2,5-dioxopyrrolidin-1-yl) 6-[6-[5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoylamino]hexanoylamino]hexanoate |
| 1H-Thieno[3,4-d]imidazole-4-pentanamide, N-[6-[[6-[(2,5-dioxo-1-pyrrolidinyl)oxy]-6-oxohexyl]amino]-6-oxohexyl]hexahydro-2-oxo-, (3aS,4S,6aR)- |
| MFCD00467154 |
| N-{6-[(2,5-Dioxo-1-pyrrolidinyl)oxy]-6-oxohexyl}-6-({5-[(3aS,4S,6aR)-2-oxohexahydro-1H-thieno[3,4-d]imidazol-4-yl]pentanoyl}amino)hexanamide |