Methyl 4-((5-bromopyrimidin-2-yl)oxy)benzoate structure
|
Common Name | Methyl 4-((5-bromopyrimidin-2-yl)oxy)benzoate | ||
|---|---|---|---|---|
| CAS Number | 926304-76-9 | Molecular Weight | 309.116 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 441.3±51.0 °C at 760 mmHg | |
| Molecular Formula | C12H9BrN2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 220.7±30.4 °C | |
| Name | methyl 4-(5-bromopyrimidin-2-yl)oxybenzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 441.3±51.0 °C at 760 mmHg |
| Molecular Formula | C12H9BrN2O3 |
| Molecular Weight | 309.116 |
| Flash Point | 220.7±30.4 °C |
| Exact Mass | 307.979645 |
| PSA | 61.31000 |
| LogP | 2.93 |
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
| Index of Refraction | 1.597 |
| InChIKey | CVRYSDLIBPCSQF-UHFFFAOYSA-N |
| SMILES | COC(=O)c1ccc(Oc2ncc(Br)cn2)cc1 |
| Storage condition | 2-8°C |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2933599090 |
|
~89%
Methyl 4-((5-br... CAS#:926304-76-9 |
| Literature: ANORMED INC. Patent: WO2007/22371 A2, 2007 ; Location in patent: Page/Page column 65 ; WO 2007/022371 A2 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Methyl 4-[(5-bromo-2-pyrimidinyl)oxy]benzoate |
| 4-(5-bromopyrimidin-2-yloxy)benzoic acid methyl ester |
| Methyl 4-[(5-bromopyrimidin-2-yl)oxy]benzoate |
| 5-bromo-2-[(4-methoxycarbonyl)phenoxy]pyrimidine |
| Benzoic acid, 4-[(5-bromo-2-pyrimidinyl)oxy]-, methyl ester |
| Methyl 4-(5-bromopyrimidin-2-yloxy)benzoate |