Iodoacetyl-LC-biotin structure
|
Common Name | Iodoacetyl-LC-biotin | ||
|---|---|---|---|---|
| CAS Number | 93285-75-7 | Molecular Weight | 510.43300 | |
| Density | 1.414g/cm3 | Boiling Point | 793.7ºC at 760 mmHg | |
| Molecular Formula | C18H31IN4O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 433.8ºC | |
Use of Iodoacetyl-LC-biotinIodoacetyl-LC-biotin is a biotinylated electrophile probe that can be used to investigate the scope and characteristics of protein covalent binding to subcellular proteomes[1][2]. |
| Name | n-iodoacetyl-n-biotinylhexylenediamine |
|---|---|
| Synonym | More Synonyms |
| Description | Iodoacetyl-LC-biotin is a biotinylated electrophile probe that can be used to investigate the scope and characteristics of protein covalent binding to subcellular proteomes[1][2]. |
|---|---|
| Related Catalog | |
| In Vitro | Iodoacetyl-LC-biotin (IAB) (50-200 μM; 6-24 h) increases LDH leakage in HEK293 cells in a time- and dose-dependant manner[1]. IAB (50-200 µM; 24 h) causes the release of cytochrome c from the mitochondria to the cytosol in HEK293 cells[1]. |
| References |
| Density | 1.414g/cm3 |
|---|---|
| Boiling Point | 793.7ºC at 760 mmHg |
| Molecular Formula | C18H31IN4O3S |
| Molecular Weight | 510.43300 |
| Flash Point | 433.8ºC |
| Exact Mass | 510.11600 |
| PSA | 124.63000 |
| LogP | 3.37940 |
| Index of Refraction | 1.559 |
| InChIKey | DNXDWMHPTVQBIP-ZQIUZPCESA-N |
| SMILES | O=C(CI)NCCCCCCNC(=O)CCCCC1SCC2NC(=O)NC21 |
| Hazard Codes | Xi |
|---|
| N-Iodoacetyl-N'-biotinyl-1,6-hexanediamine |
| N-IODOACETYL-N'-BIOTINYLHEXYLENEDIAMINE |
| iodoacetyl-LC-biotin |