Iodoacetyl-PEG4-NHS ester
Modify Date: 2025-08-27 10:45:35
Iodoacetyl-PEG4-NHS ester structure
|
Common Name | Iodoacetyl-PEG4-NHS ester | ||
|---|---|---|---|---|
| CAS Number | 2517899-65-7 | Molecular Weight | 530.31 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H27IN2O9 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Iodoacetyl-PEG4-NHS esterIodoacetyl-PEG4-NHS ester is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
| Name | Iodoacetyl-PEG4-NHS ester |
|---|
| Description | Iodoacetyl-PEG4-NHS ester is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
|---|---|
| Related Catalog | |
| Target |
PEGs |
| In Vitro | PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins[1]. |
| References |
| Molecular Formula | C17H27IN2O9 |
|---|---|
| Molecular Weight | 530.31 |
| InChIKey | ZWXHWNWXEXCATP-UHFFFAOYSA-N |
| SMILES | O=C(CI)NCCOCCOCCOCCOCCC(=O)ON1C(=O)CCC1=O |