AA 29504 structure
|
Common Name | AA 29504 | ||
|---|---|---|---|---|
| CAS Number | 945828-50-2 | Molecular Weight | 327.42 | |
| Density | 1.183±0.06 g/cm3 (20 °C, 760 mmHg) | Boiling Point | 469.6±45.0 °C (760 mmHg) | |
| Molecular Formula | C19H25N3O2 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Symbol |
GHS07 |
Signal Word | Warning | |
Use of AA 29504AA29504 is a ethyl carbamate with γ-aminobutyric acid (GABAA(HY-L120) receptor activity. AA29504 inhibits the delivery of the neurotransmitter gamma-aminobutyric acid in the central nervous system. AA29504 can be used to research anxiety, insomnia and other neuropsychiatric diseases [1]. |
| Name | Carbamic acid, N-[2-amino-4-[[(2,4,6-trimethylphenyl)methyl]amino]phenyl]-, ethyl ester |
|---|---|
| Synonym | More Synonyms |
| Description | AA29504 is a ethyl carbamate with γ-aminobutyric acid (GABAA(HY-L120) receptor activity. AA29504 inhibits the delivery of the neurotransmitter gamma-aminobutyric acid in the central nervous system. AA29504 can be used to research anxiety, insomnia and other neuropsychiatric diseases [1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.183±0.06 g/cm3 (20 °C, 760 mmHg) |
|---|---|
| Boiling Point | 469.6±45.0 °C (760 mmHg) |
| Molecular Formula | C19H25N3O2 |
| Molecular Weight | 327.42 |
| Exact Mass | 327.19500 |
| PSA | 76.38000 |
| LogP | 5.10170 |
| InChIKey | SCOOTUMXCXKEAD-UHFFFAOYSA-N |
| SMILES | CCOC(=O)Nc1ccc(NCc2c(C)cc(C)cc2C)cc1N |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H319 |
| Precautionary Statements | P305 + P351 + P338 |
| RIDADR | NONH for all modes of transport |
| AA 29504 |
| SKF 77434 hydrobromide |