EFdA-TP structure
|
Common Name | EFdA-TP | ||
|---|---|---|---|---|
| CAS Number | 950913-56-1 | Molecular Weight | 533.19 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H15FN5O12P3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of EFdA-TPEFdA-TP is a potent nucleoside reverse transcriptase (RT) inhibitor. EFdA-TP inhibits RT-catalyzed DNA synthesis as an effective immediate or delayed chain terminator (ICT or DCT). EFdA-TP inhibits HIV-1 RT with multiple mechanisms[1]. |
| Name | EFdA-TP |
|---|
| Description | EFdA-TP is a potent nucleoside reverse transcriptase (RT) inhibitor. EFdA-TP inhibits RT-catalyzed DNA synthesis as an effective immediate or delayed chain terminator (ICT or DCT). EFdA-TP inhibits HIV-1 RT with multiple mechanisms[1]. |
|---|---|
| Related Catalog | |
| Target |
HIV-1 |
| In Vitro | EFdA-TP (0.05-10 μM; for 15 min) inhibits RT-catalyzed DNA synthesis as an ICT or DCT[1]. EFdA-TP can block RT as a translocation-defective RT inhibitor that dramatically slows DNA synthesis, acting as a de facto immediate chain terminator. EFdA-TP can function as a delayed chain terminator, allowing incorporation of an additional dNTP before blocking DNA synthesis[1]. |
| References |
| Molecular Formula | C12H15FN5O12P3 |
|---|---|
| Molecular Weight | 533.19 |
| InChIKey | BUMPFXRZUYYODO-QRPMWFLTSA-N |
| SMILES | C#CC1(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)OC(n2cnc3c(N)nc(F)nc32)CC1O |
| Hazard Codes | Xi |
|---|