1-[bromo(phenyl)methyl]-4-nitrobenzene structure
|
Common Name | 1-[bromo(phenyl)methyl]-4-nitrobenzene | ||
|---|---|---|---|---|
| CAS Number | 955-43-1 | Molecular Weight | 292.12800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H10BrNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-[bromo(phenyl)methyl]-4-nitrobenzene |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C13H10BrNO2 |
|---|---|
| Molecular Weight | 292.12800 |
| Exact Mass | 290.98900 |
| PSA | 45.82000 |
| LogP | 4.60230 |
| InChIKey | OEUIOWZLQFMXJU-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc(C(Br)c2ccccc2)cc1 |
|
~22%
1-[bromo(phenyl... CAS#:955-43-1 |
| Literature: Kice, John L.; Weclas, Ludmilla Journal of Organic Chemistry, 1985 , vol. 50, # 1 p. 32 - 39 |
|
~%
1-[bromo(phenyl... CAS#:955-43-1 |
| Literature: Maslak, Przemyslaw; Guthrie, Robert D. Journal of the American Chemical Society, 1986 , vol. 108, # 10 p. 2628 - 2636 |
| 4-Nitrophenyl-phenylmethylbromid |
| 4-Nitro-diphenylmethylbromid |
| 4-nitrodiphenylmethyl bromide |
| (4-nitrophenyl)(phenyl)methyl bromide |
| Benzene,1-(bromophenylmethyl)-4-nitro |
| 4-nitrobenzhydryl bromide |
| 4-Nitro-benzhydrylbromid |