5-Hydroxyuridine structure
|
Common Name | 5-Hydroxyuridine | ||
|---|---|---|---|---|
| CAS Number | 957-77-7 | Molecular Weight | 260.20 | |
| Density | 1.8±0.1 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C9H12N2O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of 5-Hydroxyuridine5-Hydroxyuridine (OHUrd) is a purine nucleoside analogue. Purine nucleoside analogs have broad antitumor activity targeting indolent lymphoid malignancies. Anticancer mechanisms in this process rely on inhibition of DNA synthesis, induction of apoptosis, etc[1]. |
| Name | 5-hydroxyuridine |
|---|---|
| Synonym | More Synonyms |
| Description | 5-Hydroxyuridine (OHUrd) is a purine nucleoside analogue. Purine nucleoside analogs have broad antitumor activity targeting indolent lymphoid malignancies. Anticancer mechanisms in this process rely on inhibition of DNA synthesis, induction of apoptosis, etc[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.8±0.1 g/cm3 |
|---|---|
| Molecular Formula | C9H12N2O7 |
| Molecular Weight | 260.20 |
| Exact Mass | 260.064453 |
| PSA | 145.01000 |
| LogP | -1.51 |
| Index of Refraction | 1.698 |
| InChIKey | QXDXBKZJFLRLCM-UAKXSSHOSA-N |
| SMILES | O=c1[nH]c(=O)n(C2OC(CO)C(O)C2O)cc1O |
| Storage condition | 2-8°C |
| 5-Hydroxy-uridin |
| 5-Hydroxy-uracil-ribotid |
| Uridine, 5-hydroxy- |
| Uridine,5-hydroxy |
| 5-hydroxy-uridine |
| 1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-methylol-tetrahydrofuran-2-yl]-5-hydroxy-pyrimidine-2,4-quinone |
| 5-Hydroxyuridine |
| 1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-hydroxy-pyrimidine-2,4-dione |