Momordin Ic structure
|
Common Name | Momordin Ic | ||
|---|---|---|---|---|
| CAS Number | 96990-18-0 | Molecular Weight | 764.939 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 886.2±65.0 °C at 760 mmHg | |
| Molecular Formula | C41H64O13 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 263.1±27.8 °C | |
Use of Momordin IcMomordin Ic is a principal saponin constituent of Fructus Kochiae, with with anti-cancer bioactivity. Momordin Ic induces apoptosis through oxidative stress-regulated mitochondrial dysfunction[1][2]. |
| Name | (2S,3S,4S,5R,6R)-6-[[(3S,4aR,6aR,6bS,8aS,12aS,14aR,14bR)-8a-carboxy-4,4,6a,6b,11,11,14b-heptamethyl-1,2,3,4a,5,6,7,8,9,10,12,12a,14,14a-tetradecahydropicen-3-yl]oxy]-3,5-dihydroxy-4-[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxyoxane-2-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Description | Momordin Ic is a principal saponin constituent of Fructus Kochiae, with with anti-cancer bioactivity. Momordin Ic induces apoptosis through oxidative stress-regulated mitochondrial dysfunction[1][2]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 886.2±65.0 °C at 760 mmHg |
| Molecular Formula | C41H64O13 |
| Molecular Weight | 764.939 |
| Flash Point | 263.1±27.8 °C |
| Exact Mass | 764.434692 |
| PSA | 212.67000 |
| LogP | 9.87 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.606 |
| InChIKey | HWYBGIDROCYPOE-WEAQAMGWSA-N |
| SMILES | CC1(C)CCC2(C(=O)O)CCC3(C)C(=CCC4C5(C)CCC(OC6OC(C(=O)O)C(O)C(OC7OCC(O)C(O)C7O)C6O)C(C)(C)C5CCC43C)C2C1 |
| Safety Phrases | 24/25 |
|---|
| Precursor 0 | |
|---|---|
| DownStream 2 | |
| (3β)-28-Hydroxy-28-oxoolean-12-en-3-yl 3-O-β-D-xylopyranosyl-β-D-glucopyranosiduronic acid |
| oleanolic acid 3-O-monodesmoside |
| MomordinIc |
| X1188 |
| Olean-12-en-28-oic acid, 3-[(3-O-β-D-xylopyranosyl-β-D-glucopyranuronosyl)oxy]-, (3β)- |
| Scoparianoside B |
| Momordin Ic |