Baicalein-5,6,7-trimethylether structure
|
Common Name | Baicalein-5,6,7-trimethylether | ||
|---|---|---|---|---|
| CAS Number | 973-67-1 | Molecular Weight | 312.31700 | |
| Density | 1.242g/cm3 | Boiling Point | 497.4ºC at 760 mmHg | |
| Molecular Formula | C18H16O5 | Melting Point | 165-167°C | |
| MSDS | N/A | Flash Point | 221.3ºC | |
Use of Baicalein-5,6,7-trimethylether5,6,7-Trimethoxyflavone is a novel p38-α MAPK inhibitor with an anti-inflammatory effect. 5,6,7-Trimethoxyflavone is isolated from several plants including Zeyhera tuberculosa, Callicarpa japonica, and Kickxia lanigera[1]. |
| Name | 5,6,7-trimethoxyflavone |
|---|---|
| Synonym | More Synonyms |
| Description | 5,6,7-Trimethoxyflavone is a novel p38-α MAPK inhibitor with an anti-inflammatory effect. 5,6,7-Trimethoxyflavone is isolated from several plants including Zeyhera tuberculosa, Callicarpa japonica, and Kickxia lanigera[1]. |
|---|---|
| Related Catalog | |
| Target |
p38-α MAPK[1] |
| References |
| Density | 1.242g/cm3 |
|---|---|
| Boiling Point | 497.4ºC at 760 mmHg |
| Melting Point | 165-167°C |
| Molecular Formula | C18H16O5 |
| Molecular Weight | 312.31700 |
| Flash Point | 221.3ºC |
| Exact Mass | 312.10000 |
| PSA | 57.90000 |
| LogP | 3.48580 |
| Index of Refraction | 1.585 |
| InChIKey | HJNJAUYFFFOFBW-UHFFFAOYSA-N |
| SMILES | COc1cc2oc(-c3ccccc3)cc(=O)c2c(OC)c1OC |
| Storage condition | -20℃ |
| Hazard Codes | Xi: Irritant; |
|---|---|
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36/37/39 |
| HS Code | 2914509090 |
| HS Code | 2914509090 |
|---|---|
| Summary | HS:2914509090 other ketones with other oxygen function VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 5,6,7-trimethoxy-2-phenylchromen-4-one |
| 5,6,7-Trimethoxyflavone |
| 5,6,7-trimethoxy-2-phenyl-4H-chromen-4-one |
| Baicalein-5,6,7-trimethylether |
| 5,6,7-trimethoxy-2-phenyl-4H-1-benzopyran-4-one |
| Baicalein Trimethyl Ether |
| 5,6,7-Trimethoxy-2-phenyl-chromen-4-on |
| MFCD00017457 |
| 5,6,7-trimethoxy-2-phenyl-chromen-4-one |