N-(4-Cyano-3-(trifluoromethyl)phenyl)acetamide structure
|
Common Name | N-(4-Cyano-3-(trifluoromethyl)phenyl)acetamide | ||
|---|---|---|---|---|
| CAS Number | 97760-99-1 | Molecular Weight | 228.17100 | |
| Density | 1.34g/cm3 | Boiling Point | 381.4ºC at 760 mmHg | |
| Molecular Formula | C10H7F3N2O | Melting Point | 170ºC | |
| MSDS | N/A | Flash Point | 184.5ºC | |
| Name | N-[4-cyano-3-(trifluoromethyl)phenyl]acetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.34g/cm3 |
|---|---|
| Boiling Point | 381.4ºC at 760 mmHg |
| Melting Point | 170ºC |
| Molecular Formula | C10H7F3N2O |
| Molecular Weight | 228.17100 |
| Flash Point | 184.5ºC |
| Exact Mass | 228.05100 |
| PSA | 52.89000 |
| LogP | 2.60848 |
| Index of Refraction | 1.493 |
| InChIKey | FHKLGEQKLMMVCZ-UHFFFAOYSA-N |
| SMILES | CC(=O)Nc1ccc(C#N)c(C(F)(F)F)c1 |
|
~0%
N-(4-Cyano-3-(t... CAS#:97760-99-1
Detail
|
| Literature: Tetrahedron Letters, , vol. 48, # 6 p. 979 - 983 |
|
~%
N-(4-Cyano-3-(t... CAS#:97760-99-1 |
| Literature: Bioorganic and Medicinal Chemistry Letters, , vol. 17, # 7 p. 1860 - 1864 |
|
~%
N-(4-Cyano-3-(t... CAS#:97760-99-1 |
| Literature: Bioorganic and Medicinal Chemistry Letters, , vol. 17, # 7 p. 1860 - 1864 |
|
~%
N-(4-Cyano-3-(t... CAS#:97760-99-1 |
| Literature: Bioorganic and Medicinal Chemistry Letters, , vol. 17, # 7 p. 1860 - 1864 |
| n-(4-cyano-3-(trifluoromethyl)phenyl)acetamide |
| 4'-cyano-3'-(trifluoromethyl)acetanilide |