LY-281217 structure
|
Common Name | LY-281217 | ||
|---|---|---|---|---|
| CAS Number | 105027-75-6 | Molecular Weight | 578.69900 | |
| Density | 1.199g/cm3 | Boiling Point | 786.4ºC at 760 mmHg | |
| Molecular Formula | C32H42N4O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 429.4ºC | |
Use of LY-281217LY-281217 is a potent mu-opioid agonist with analgesic effects[1]. |
| Name | ly 281217 |
|---|
| Description | LY-281217 is a potent mu-opioid agonist with analgesic effects[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.199g/cm3 |
|---|---|
| Boiling Point | 786.4ºC at 760 mmHg |
| Molecular Formula | C32H42N4O6 |
| Molecular Weight | 578.69900 |
| Flash Point | 429.4ºC |
| Exact Mass | 578.31000 |
| PSA | 148.07000 |
| LogP | 3.75170 |
| Vapour Pressure | 4.72E-26mmHg at 25°C |
| Index of Refraction | 1.582 |
| InChIKey | VDDWKCVNBQGFFF-UIOOFZCWSA-N |
| SMILES | C=CCN(CC=C)C(Cc1ccc(O)cc1)C(=O)NC(C)(C)C(=O)NC(C)(C)C(=O)NC(Cc1ccccc1)C(=O)O |