GDC-0834 (S-enantiomer) structure
|
Common Name | GDC-0834 (S-enantiomer) | ||
|---|---|---|---|---|
| CAS Number | 1133432-50-4 | Molecular Weight | 596.74200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C33H36N6O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of GDC-0834 (S-enantiomer)GDC-0834 (S-enantiomer) is the S-enantiomer of GDC-0834. GDC-0834 is a potent and selective BTK inhibitor. |
| Name | N-[3-[6-[4-[(2S)-1,4-dimethyl-3-oxopiperazin-2-yl]anilino]-4-methyl-5-oxopyrazin-2-yl]-2-methylphenyl]-4,5,6,7-tetrahydro-1-benzothiophene-2-carboxamide |
|---|---|
| Synonym | More Synonyms |
| Description | GDC-0834 (S-enantiomer) is the S-enantiomer of GDC-0834. GDC-0834 is a potent and selective BTK inhibitor. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C33H36N6O3S |
|---|---|
| Molecular Weight | 596.74200 |
| Exact Mass | 596.25700 |
| PSA | 131.04000 |
| LogP | 4.50750 |
| InChIKey | CDOOFZZILLRUQH-LJAQVGFWSA-N |
| SMILES | Cc1c(NC(=O)c2cc3c(s2)CCCC3)cccc1-c1cn(C)c(=O)c(Nc2ccc(C3C(=O)N(C)CCN3C)cc2)n1 |
| Storage condition | -20℃ |
| s7022,gdc0834 |
| gdc-0834 |
| GDC-0834 (S-enantiomer) |