EX-527 (S-enantiomer) structure
|
Common Name | EX-527 (S-enantiomer) | ||
|---|---|---|---|---|
| CAS Number | 848193-68-0 | Molecular Weight | 248.708 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 531.7±38.0 °C at 760 mmHg | |
| Molecular Formula | C13H13ClN2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 275.4±26.8 °C | |
Use of EX-527 (S-enantiomer)Selisistat S-enantiomer (EX-527 S-enantiomer) is the S-enantiomer of Selisistat, with an IC50 of 123 nM for SIRT1. Selisistat S-enantiomer is much more potent than Selisistat R-enantiomer. |
| Name | (1S)-6-chloro-2,3,4,9-tetrahydro-1H-carbazole-1-carboxamide |
|---|---|
| Synonym | More Synonyms |
| Description | Selisistat S-enantiomer (EX-527 S-enantiomer) is the S-enantiomer of Selisistat, with an IC50 of 123 nM for SIRT1. Selisistat S-enantiomer is much more potent than Selisistat R-enantiomer. |
|---|---|
| Related Catalog | |
| Target |
SIRT1:123 nM (IC50) |
| References |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 531.7±38.0 °C at 760 mmHg |
| Molecular Formula | C13H13ClN2O |
| Molecular Weight | 248.708 |
| Flash Point | 275.4±26.8 °C |
| Exact Mass | 248.071640 |
| PSA | 59.87000 |
| LogP | 2.22 |
| Vapour Pressure | 0.0±1.4 mmHg at 25°C |
| Index of Refraction | 1.688 |
| InChIKey | FUZYTVDVLBBXDL-VIFPVBQESA-N |
| SMILES | NC(=O)C1CCCc2c1[nH]c1ccc(Cl)cc21 |
| (S)-selisistat |
| OCZ |
| S1541_Selleck |
| (1S)-6-Chloro-2,3,4,9-tetrahydro-1H-carbazole-1-carboxamide |
| cc-651 |
| 1H-Carbazole-1-carboxamide, 6-chloro-2,3,4,9-tetrahydro-, (1S)- |
| EX527 |
| EX-527 S-enantiomer |
| EX-527 (S-enantiomer) |