Daidzein dimethyl ether structure
|
Common Name | Daidzein dimethyl ether | ||
|---|---|---|---|---|
| CAS Number | 1157-39-7 | Molecular Weight | 282.29100 | |
| Density | 1.242g/cm3 | Boiling Point | 452.8ºC at 760mmHg | |
| Molecular Formula | C17H14O4 | Melting Point | 161-163°C | |
| MSDS | N/A | Flash Point | 202.2ºC | |
Use of Daidzein dimethyl ether4',7-Dimethoxyisoflavone is isolated from the leaves of Albizzia lebbeck, which shows antifungal activity. |
| Name | 7-methoxy-3-(4-methoxyphenyl)chromen-4-one |
|---|---|
| Synonym | More Synonyms |
| Description | 4',7-Dimethoxyisoflavone is isolated from the leaves of Albizzia lebbeck, which shows antifungal activity. |
|---|---|
| Related Catalog | |
| In Vitro | 4',7-Dimethoxyisoflavone shows antifungal activity against some plant pathogenic fungi tested in vitro, and the sensitivity of different fungi to this chemical varied considerably[1]. |
| References |
| Density | 1.242g/cm3 |
|---|---|
| Boiling Point | 452.8ºC at 760mmHg |
| Melting Point | 161-163°C |
| Molecular Formula | C17H14O4 |
| Molecular Weight | 282.29100 |
| Flash Point | 202.2ºC |
| Exact Mass | 282.08900 |
| PSA | 48.67000 |
| LogP | 3.47720 |
| Vapour Pressure | 2.18E-08mmHg at 25°C |
| Index of Refraction | 1.598 |
| InChIKey | LPNBCGIVZXHHHO-UHFFFAOYSA-N |
| SMILES | COc1ccc(-c2coc3cc(OC)ccc3c2=O)cc1 |
| Safety Phrases | S22-S24/25 |
|---|---|
| WGK Germany | 3 |
| HS Code | 2914509090 |
| Precursor 10 | |
|---|---|
| DownStream 3 | |
| HS Code | 2914509090 |
|---|---|
| Summary | HS:2914509090 other ketones with other oxygen function VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 7-Methoxy-3-(4-methoxyphenyl)chromone |
| 7,4'-dimethoxyisoflavone |
| 7-methoxy-3-(4-methoxyphenyl)-4H-1-benzopyran-4-one |
| Daidzein dimethyl ether |
| 4′,7-Dimethoxyisoflavone |
| dimethyldiadzein |
| 7,4'-diMe-D |
| 7-methoxy-3-(4-methoxyphenyl)-4H-chromen-4-one |
| 7-methoxy-3-(4-methoxy-phenyl)-chromen-4-one |
| MFCD00075889 |
| 4',7-Dimethoxyisoflavone |