1,2,3-Trimethoxydibenzo[cd,f]indol-4(5H)-one structure
|
Common Name | 1,2,3-Trimethoxydibenzo[cd,f]indol-4(5H)-one | ||
|---|---|---|---|---|
| CAS Number | 116064-76-7 | Molecular Weight | 309.32 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 467.2±45.0 °C at 760 mmHg | |
| Molecular Formula | C18H15NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 236.3±28.7 °C | |
Use of 1,2,3-Trimethoxydibenzo[cd,f]indol-4(5H)-onePiperolactam C (O-Methylpiperolactam B) is a natural alkaloid with anti-platelet aggregation effects[1]. |
| Name | Piperolactam C |
|---|---|
| Synonym | More Synonyms |
| Description | Piperolactam C (O-Methylpiperolactam B) is a natural alkaloid with anti-platelet aggregation effects[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 467.2±45.0 °C at 760 mmHg |
| Molecular Formula | C18H15NO4 |
| Molecular Weight | 309.32 |
| Flash Point | 236.3±28.7 °C |
| Exact Mass | 309.100098 |
| PSA | 60.55000 |
| LogP | 3.02 |
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |
| Index of Refraction | 1.681 |
| InChIKey | GYYIMUXZCUHECT-UHFFFAOYSA-N |
| SMILES | COc1c(OC)c(OC)c2c3c(cc4ccccc42)NC(=O)c13 |
| Hazard Codes | Xi |
|---|
| Dibenz[cd,f]indol-4(5H)-one, 1,2,3-trimethoxy- |
| 1,2,3-Trimethoxydibenzo[cd,f]indol-4(5H)-one |