Propargyl-PEG6-N3 structure
|
Common Name | Propargyl-PEG6-N3 | ||
|---|---|---|---|---|
| CAS Number | 1198080-03-3 | Molecular Weight | 345.391 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H27N3O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Propargyl-PEG6-N3Propargyl-PEG6-N3 is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
| Name | 1-Azido-3,6,9,12,15,18-hexaoxahenicos-20-yne |
|---|---|
| Synonym | More Synonyms |
| Description | Propargyl-PEG6-N3 is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
|---|---|
| Related Catalog | |
| Target |
PEGs |
| In Vitro | PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins[1]. |
| References |
| Molecular Formula | C15H27N3O6 |
|---|---|
| Molecular Weight | 345.391 |
| Exact Mass | 345.189972 |
| LogP | -1.04 |
| InChIKey | PZHVNVDINOLKDX-UHFFFAOYSA-N |
| SMILES | C#CCOCCOCCOCCOCCOCCOCCN=[N+]=[N-] |
| 1-Azido-3,6,9,12,15,18-hexaoxahenicos-20-yne |
| 3,6,9,12,15,18-Hexaoxaheneicos-20-yne, 1-azido- |