SCD1 inhibitor structure
|
Common Name | SCD1 inhibitor | ||
|---|---|---|---|---|
| CAS Number | 1231243-91-6 | Molecular Weight | 419.39700 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C21H20F3N3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of SCD1 inhibitorA novel stearoyl-CoA desaturase1 (SCD1) inhibitor.The compound exhibited robust in vivo activity with dose-dependent desaturation index lowering effects. |
| Name | N-[4-[2-methoxyethyl(methyl)amino]phenyl]-2-phenyl-5-(trifluoromethyl)-1,3-oxazole-4-carboxamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Molecular Formula | C21H20F3N3O3 |
| Molecular Weight | 419.39700 |
| Exact Mass | 419.14600 |
| PSA | 67.60000 |
| LogP | 2.86 |
| Index of Refraction | 1.576 |
| InChIKey | GLLFNZDVMSLOCL-UHFFFAOYSA-N |
| SMILES | CN(CCOC)C1=CC=C(C=C1)NC(=O)C2=C(OC(=N2)C3=CC=CC=C3)C(F)(F)F |
| HS Code | 2934999090 |
|---|
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-phenyl-5-trifluoromethyloxazole-4-carboxylic acid {4-[(2-methoxyethyl)(methyl)amino]phenyl}amide |
| N-(4-((2-Methoxyethyl)(methyl)amino)phenyl)-2-phenyl-5-(trifluoromethyl)oxazole-4-carboxamide |
| 4-Oxazolecarboxamide, N-[4-[(2-methoxyethyl)methylamino]phenyl]-2-phenyl-5-(trifluoromethyl)- |
| SCD1 inhibitor |