Boc-Aminooxy-PEG3-azide structure
|
Common Name | Boc-Aminooxy-PEG3-azide | ||
|---|---|---|---|---|
| CAS Number | 1235514-15-4 | Molecular Weight | 334.369 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H26N4O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Boc-Aminooxy-PEG3-azideBoc-Aminooxy-PEG3-azide is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
| Name | t-Boc-Aminoxy-PEG3-Azide |
|---|---|
| Synonym | More Synonyms |
| Description | Boc-Aminooxy-PEG3-azide is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
|---|---|
| Related Catalog | |
| Target |
PEGs Alkyl/ether |
| In Vitro | PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins[1]. |
| References |
| Molecular Formula | C13H26N4O6 |
|---|---|
| Molecular Weight | 334.369 |
| Exact Mass | 334.185242 |
| LogP | 0.98 |
| InChIKey | NMMKIEUJNULAEQ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NOCCOCCOCCOCCN=[N+]=[N-] |
| Carbamic acid, N-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethoxy]-, 1,1-dimethylethyl ester |
| MFCD28950781 |
| 2-Methyl-2-propanyl (2-{2-[2-(2-azidoethoxy)ethoxy]ethoxy}ethoxy)carbamate |