Ald-Ph-amido-PEG11-NH-Boc structure
|
Common Name | Ald-Ph-amido-PEG11-NH-Boc | ||
|---|---|---|---|---|
| CAS Number | 1245813-70-0 | Molecular Weight | 776.91 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C37H64N2O15 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Ald-Ph-amido-PEG11-NH-BocAld-Ph-amido-PEG11-NH-Boc is a non-cleavable 11 unit PEG ADC linker used in the synthesis of antibody-drug conjugates (ADCs)[1]. |
| Name | Ald-Ph-amido-PEG11-NH-Boc |
|---|
| Description | Ald-Ph-amido-PEG11-NH-Boc is a non-cleavable 11 unit PEG ADC linker used in the synthesis of antibody-drug conjugates (ADCs)[1]. |
|---|---|
| Related Catalog | |
| Target |
Non-cleavable |
| In Vitro | ADCs are comprised of an antibody to which is attached an ADC cytotoxin through an ADC linker[1]. |
| References |
| Molecular Formula | C37H64N2O15 |
|---|---|
| Molecular Weight | 776.91 |
| InChIKey | RDSLXILMKJRJBU-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCNC(=O)c1ccc(C=O)cc1 |